Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-브로모-1,8-나프탈산무수물
3-브로모-1,8-나프탈산무수물 · 5-Bromo-1H,3H-benzo[de]isochromene-1,3-dione · 3-Bromo-1,8-phthalic anhydride · 3-bromonaphthalic-1,8-anhydride · 3-Bromo-1,8-naphthalic anhydride · 5-BroMobenzo[de]isochroMene-1,3-dione · 2,2'-Biquinoline-4,4'-diyl bis(germane) · 1H,3H-Naphtho[1,8-cd]pyran-1,3-dione, 5-broMo-
식별자 및 물리적 특성
| CAS No. | 24050-49-5 |
|---|---|
| 분자식 | C12H5BrO3 |
| 평균 분자량 | 277.07 g/mol |
| 단동위원소 질량 | 275.94220612 g/mol |
| SMILES | O=C1OC(=O)c2cc(Br)cc3cccc1c23 |
| InChIKey | LYXFXCSFCWZGNZ-UHFFFAOYSA-N |
| PubChem CID | 3907491 |
| EC No. | 681-858-9 |
| DTXSID | DTXSID20397888 |
| 현지명 | 3-브로모-1,8-나프탈산무수물 |
화학 및 물리적 성질
| XLogP | 3.2 |
|---|---|
| 극성 표면적 | 43.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 341 |
| 녹는점 | 244-246°C |
| 끓는 점 | 468.9±28.0 °C(Predicted) |
| 밀도 | 1.812±0.06 g/cm3 (20 ºC 760 Torr) |
| 저장 조건 | Store at room temperature |
| BRN | 180001 |
| InChI | InChI=1S/C12H5BrO3/c13-7-4-6-2-1-3-8-10(6)9(5-7)12(15)16-11(8)14/h1-5H |
| InChIKey | LYXFXCSFCWZGNZ-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(=O)C2=CC(Br)=CC3=C2C1=CC=C3 |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 4 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 위험 문구(R) | 36/37/38 |
| 안전 문구(S) | 26-36 |
용도
개요
3-Bromo-1,8-naphthalic anhydride is a naphthalic anhydride compound. Its structure incorporates a bromo functional group, meaning this product can participate in various chemical reactions and serve as a synthetic reagent for preparing photocatalysts, pharmaceutical preparations, or other organic heterocyclic compounds.