Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Clopirac
clopirac · CP-172AP · BRL-13856 · 1-(4-chlorophenyl)-2,5-dimethyl-1h-pyrrole-3-aceticaci · 1-(4-chlorophenyl)-2,5-dimethyl-1h-pyrrole-3-aceticacid · 2-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]acetic acid · 1H-Pyrrole-3-acetic acid, 1-(4-chlorophenyl)-2,5-dimethyl- · 2-(1-(4-chlorophenyl)-2,5-dimethyl-1H-pyrrol-3-yl)acetic acid
식별자 및 물리적 특성
| CAS No. | 42779-82-8 |
|---|---|
| 분자식 | C14H14ClNO2 |
| 평균 분자량 | 263.72 g/mol |
| 단동위원소 질량 | 263.0713064 g/mol |
| SMILES | Cc1cc(CC(=O)O)c(C)n1-c1ccc(Cl)cc1 |
| InChIKey | SJCRQMUYEQHNTC-UHFFFAOYSA-N |
| PubChem CID | 39299 |
| ChEMBL | CHEMBL1718918 |
| ChEBI | CHEBI:135087 |
| EC No. | 255-938-5 |
| DTXSID | DTXSID9046158 |
화학 및 물리적 성질
| XLogP | 3.2 |
|---|---|
| 극성 표면적 | 42.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 302 |
| 끓는 점 | 429.1±45.0 °C(Predicted) |
| 밀도 | 1.23±0.1 g/cm3(Predicted) |
| pKa(산도 계수) | 4.38±0.10(Predicted) |
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 신호 어 | Warning |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
용도
용도
Anti-inflammatory.