Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-비닐-벤잘데하이드
4-비닐-벤잘데하이드 · 4-Formylstyrene · p-Formylstyrene · p-vinylbenzaldehyde · 4-Ethenylbenzaldehyde · Benzaldehyde,4-ethenyl · 4-Vinylbenzaldehyde，97% · 4-Vinyl-benzaldehyde
식별자 및 물리적 특성
| CAS No. | 1791-26-0 |
|---|---|
| 분자식 | C9H8O |
| 평균 분자량 | 132.16 g/mol |
| 단동위원소 질량 | 132.05751488 g/mol |
| SMILES | C=Cc1ccc(C=O)cc1 |
| InChIKey | QBFNGLBSVFKILI-UHFFFAOYSA-N |
| PubChem CID | 39389 |
| EC No. | 829-065-0 |
| DTXSID | DTXSID70170769 |
| 현지명 | 4-비닐-벤잘데하이드 |
화학 및 물리적 성질
| XLogP | 2.2 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 121 |
| 녹는점 | 129-131 °C |
| 끓는 점 | 92-93 °C(Press: 14 Torr) |
| 밀도 | 1.036 g/cm3(Temp: 25 °C) |
| 저장 조건 | Inert atmosphere,Store in freezer, under -20°C |
| InChI | InChI=1S/C9H8O/c1-2-8-3-5-9(7-10)6-4-8/h2-7H,1H2 |
| InChIKey | QBFNGLBSVFKILI-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(C=C)C=C1 |
안전 및 규제
| GHS 분류 | WarningH227 (100%): Combustible liquid [Warning Flammable liquids]P203, P210, P261, P264, P264+P265, P270, P271, P273, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P318, P319, P321, P330, P332+P317, P337+P317, P362+P364, P370+P378, P403, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 2 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 4 (100%) |
| 신호 어 | Warning |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
용도
용도
4-Vinylbenzaldehyde is a mushroom tyrosinase inhibitor.