Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-((4-Methylphenyl)sulfonyl)-5-nitrofuran
NSC697923 · NSC697923 USP/EP/BP · 2-Nitro-5-tosylfuran · NSC697923, 10 mM in DMSO · NSC697923, UBE2N inhibitor · UbcH13 Inhibitor, NSC697923 · 2-Nitro-5-(toluene-4-sulfonyl)-furan · 2-[(4-Methylphenyl)sulfonyl]-5-nitrofur
식별자 및 물리적 특성
| CAS No. | 343351-67-7 |
|---|---|
| 분자식 | C11H9NO5S |
| 평균 분자량 | 267.26 g/mol |
| 단동위원소 질량 | 267.02014356 g/mol |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc([N+](=O)[O-])o2)cc1 |
| InChIKey | GAUHIPWCDXOLCZ-UHFFFAOYSA-N |
| PubChem CID | 394449 |
| ChEMBL | CHEMBL1698008 |
| EC No. | 803-500-4 |
화학 및 물리적 성질
| XLogP | 2.6 |
|---|---|
| 극성 표면적 | 101 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 402 |
| 녹는점 | 124-126°C |
| 끓는 점 | 443.8±40.0 °C(Predicted) |
| 밀도 | 1.416±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Store in freezer, under -20°C |
| 용해도 | DMSO: 용해성20mg/mL, 투명 |
| 물리적 상태 | 가루 |
| 색상 | 흰색에서 베이지색 |
| 안정성 | 제공된 대로 구매일로부터 1년 동안 안정적입니다. DMSO 또는 에탄올 용액은 -20°C에서 최대 1개월 동안 보관할 수 있습니다. |
| InChI | 1S/C11H9NO5S/c1-8-2-4-9(5-3-8)18(15,16)11-7-6-10(17-11)12(13)14/h2-7H,1H3 |
| InChIKey | GAUHIPWCDXOLCZ-UHFFFAOYSA-N |
| SMILES | [S](=O)(=O)(c2[o]c(cc2)[N+](=O)[O-])c1ccc(cc1)C |
안전 및 규제
| GHS 분류 | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P317, P305+P354+P338, P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 위험 문구(R) | 22-41 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26-39 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
NSC 697923 is a cell-permeable and selective inhibitor of the ubiquitin-conjugating (E2) enzyme Ubc13-Uev1A and exhibits potent cytotoxicity in a panel of Neuroblastoma (NB) cell lines. NSC 697923 also inhibits the proliferation and survival of diffuse large B-cell lymphoma cells (DLBCL).