Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,2-비스(2-니트로페녹시)에탄
1,2-비스(2-니트로페녹시)에탄 · Bis(o-nitrophenoxy)ethane · 1,2-BIS(O-NITROPHENOXY)ETHANE · 1,2-BIS(2-NITROPHENOXY)ETHANE · EthyleneGlycolBis(2-nitrophenyl)Ether>Ethylene Glycol Bis(2-nitrophenyl) Ether · 1-Nitro-2-[2-(2-nitrophenoxy)ethoxy]benzene · 1,1'-[1,2-Ethanediylbis(oxy)]bis[2-nitrobenzene · Benzene, 1,1'-[1,2-ethanediylbis(oxy)]bis[2-nitro-
식별자 및 물리적 특성
| CAS No. | 51661-19-9 |
|---|---|
| 분자식 | C14H12N2O6 |
| 평균 분자량 | 304.25 g/mol |
| 단동위원소 질량 | 304.06953611 g/mol |
| SMILES | O=[N+]([O-])c1ccccc1OCCOc1ccccc1[N+](=O)[O-] |
| InChIKey | DEHTVRKGDUCXRF-UHFFFAOYSA-N |
| PubChem CID | 394580 |
| ChEMBL | CHEMBL1370295 |
| EC No. | 610-713-4 |
| DTXSID | DTXSID30963836 |
| 현지명 | 1,2-비스(2-니트로페녹시)에탄 |
화학 및 물리적 성질
| XLogP | 3.2 |
|---|---|
| 극성 표면적 | 110 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 22 |
| 형식 전하 | 0 |
| 복잡도 | 345 |
| 용해도 | <0.3 [ug/mL] (The mean of the results at pH 7.4)에탄올, 테트라히드로푸란 에 용해됨 |
| 녹는점 | 167-170°C |
| 끓는 점 | 501.7±35.0 °C(Predicted) |
| 밀도 | 1.370±0.06 g/cm3(Predicted) |
| 저장 조건 | 2-8°C |
| 물리적 상태 | 고체 |
| 색상 | 갈색을 띤 노란색 |
화학적 성질
Yellow Crystalline Solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P273, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P391, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 운송 번호(UN) | 2810 |
| 관세 코드 | 2909.30.6000 |
| 위험 문구(R) | 23/24/25-36/37/38 |
| 안전 문구(S) | 26-36/37/39 |
| 포장분류 | III |