티디아주론
티디아주론 · 1-페닐-3-3(1,2,3-시아디아졸-5-일)우레아 · TDZ · Thiadiazuron · Thidiazurone · Lift · DROPP · defolit
식별자 및 물리적 특성
| CAS No. | 51707-55-2 |
|---|---|
| 분자식 | C9H8N4OS |
| 평균 분자량 | 220.25 g/mol |
| 단동위원소 질량 | 220.04188206 g/mol |
| SMILES | O=C(Nc1ccccc1)Nc1cnns1 |
| InChIKey | HFCYZXMHUIHAQI-UHFFFAOYSA-N |
| PubChem CID | 40087 |
| ChEMBL | CHEMBL505661 |
| ChEBI | CHEBI:81977 |
| EC No. | 257-356-7 |
| DTXSID | DTXSID0032651 |
| 현지명 | 티디아주론 |
화학 및 물리적 성질
| XLogP | 1.3 |
|---|---|
| 극성 표면적 | 95.2 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 220 |
| 녹는점 | 213°C |
| 밀도 | 1.3493 (rough estimate) |
| 굴절률 | 1.6390 (estimate) |
| 저장 조건 | Sealed in dry,2-8°C |
| 용해도 | DMSO에 용해됨 |
| pKa(산도 계수) | 12.06±0.70(Predicted) |
| 물리적 상태 | Solid |
| 색상 | Light yellow to yellow |
| Merck | 13,9384 |
| BRN | 1078092 |
| 헨리 상수 | 3.0×107 mol/(m3Pa) at 25℃, HSDB (2015) |
| 주요 응용 | 농업 |
| InChI | InChI=1S/C9H8N4OS/c14-9(12-8-6-10-13-15-8)11-7-4-2-1-3-5-7/h1-6H,(H2,11,12,14) |
| InChIKey | HFCYZXMHUIHAQI-UHFFFAOYSA-N |
| SMILES | N(C1=CC=CC=C1)C(NC1SN=NC=1)=O |
| EPA | Thidiazuron (51707-55-2) |
화학적 성질
The pure product is a white odorless and tasteless crystalline solid. m.p.210～212.5°C (decomposition at 217°C), vapor pressure 4×10-9Pa) (25°C). Solubility at 25°C: dimethyl sulfoxide>500g/L, dimethylformamide>500g/L, cyclohexanone 21.5g/L, acetone 8g/L, methanol 4.5g/L, ethyl acetate 0.8 g/L, hexane 6mg/L, insoluble in aliphatic and aromatic hydrocarbons, solubility in water 31mg/L. The partition coefficient is 59 (pH=7.3). Stable below 200°C; stable to water at room temperature, half-life > 24d; half-life in soil
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| RTECS 번호 | YU1395000 |
| 운송 번호(UN) | UN 3077 9 / PGIII |
| 독성 | LC50 (96-hour) for bluegill sunsh, channel catsh and rainbow trout >1,000 mg/L (Hartley and Kidd, 1987)acute oral LD50 for rats >5,000 mg/kg (Hartley and Kidd, 1987), 5,350 mg/kg (RTECS, 1985). |
| 관세 코드 | 2934999090 |
| 위험 문구(R) | 36/37/38-51/53 |
| 위험 표시 | Xi,N |
| 안전 문구(S) | 22-26-36-61 |
| 기존화학 물질 | 2013-3-5629 |
| 위험 등급 | Aquatic Acute 1Aquatic Chronic 1Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
| 유해 물질 데이터 | 51707-55-2(Hazardous Substances Data) |
용도
용도
Thidiazuron is a non-purine containing urea derivative with cytokinin activity. Thidiazuron is used as a cotton defoliant and a plant growth regulator in tissue culture.
일반 설명
Thidiazuron is a systemic herbicide, widely employed as an effective plant growth regulator and pre-harvest defoliant for crops such as cotton.