페놀 레드 용액 0.02%
페놀레드용액0.02% · 페놀레드용액0.02%(PHENOLREDSOLUTION0.02%) · PHENOLSULFONPHTHALEIN · PHENOL RED INDICATOR · ANTHRACENE NEAT · abcolphenolredws · SODIUM PHENOL RED · ACENAPHTHENE NEAT
식별자 및 물리적 특성
| CAS No. | 34487-61-1 |
|---|---|
| 분자식 | C19H13NaO5S |
| 평균 분자량 | 376.4 g/mol |
| 단동위원소 질량 | 376.03813897 g/mol |
| SMILES | O=C1C=CC(=C(c2ccc(O)cc2)c2ccccc2S(=O)(=O)[O-])C=C1.[Na+] |
| InChIKey | RBFZWTMVVUVHLM-UHFFFAOYSA-M |
| PubChem CID | 4013450 |
| 현지명 | 페놀 레드 용액 0.02% |
화학 및 물리적 성질
| 극성 표면적 | 103 |
|---|---|
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 26 |
| 형식 전하 | 0 |
| 복잡도 | 691 |
| 녹는점 | 285 °C (dec.)(lit.) |
| 끓는 점 | 285 °C |
| 밀도 | 0.972 |
| 저장 조건 | room temp |
| 용해도 | H2O: 명확성 테스트 통과 |
| 물리적 상태 | 샤이니 핑크 |
| pKa(산도 계수) | 7.69, 7.9, 1.3(at 25℃) |
| 색상 | 하얀색 |
| 냄새 | 냄새 없는 |
| 용해도 | 녹는 |
| Merck | 14,7247 |
| BRN | 6260026 |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| 주요 응용 | 센서, 광학 장치, 페인트, 살균 공정, 비료, 생존 세포 검출, 위장관 점막, 항균제, 의약품, 약리학 |
| InChI | 1S/C19H14O5S.Na/c20-15-9-5-13(6-10-15)19(14-7-11-16(21)12-8-14)17-3-1-2-4-18(17)25(22,23)24-19/h1-12,20-21H/q+1/p-1 |
| InChIKey | HKHYOKBQJILTEI-UHFFFAOYSA-M |
| SMILES | [Na+].Oc1ccc(cc1)C2(OS(=O)(=O)c3ccccc23)c4ccc([O-])cc4 |
| EPA | Phenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis-, monosodium salt (34487-61-1) |
화학적 성질
red liquid or red/brown crystals, slightly soluble in water, alcohol and acetone. Almost insoluble in ether and chloroform, soluble in hydroxide base or carbonate base solution with deep red color, stable in air, used as acid-base indicator.
안전 및 규제
| 규제 정보 | Phenol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis-, monosodium salt: Does not have an individual approval but may be used under an appropriate group standard |
|---|---|
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29349990 |
| 위험 문구(R) | 36/37/38-34 |
| 위험 표시 | Xi,C |
| 안전 문구(S) | 26-36-37/39-45-36/37/39-27 |
| 기존화학 물질 | KE-02749 |
| 위험 등급 | Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Phenol Red Sodium Salt is a water soluble pH indicator commonly employed in cell biology laboratories as a cell tissue culture pH marker. Phenol Red sodium salt is a water soluble pH indicator used in the 6.8 (yellow) to 8.2 (red) range. It is commonly employed in cell biology laboratories as a cell tissue culture pH marker. Under normal conditions, phenol red added to the growth medium will have a pink-red color. Usually 15 mg/l is used to produce this effect. If problems arise, such as dying cells or overgrowth of contaminants, this will cause a change in pH resulting in a change in indicator color. This color change is an indication that the medium needs to be replaced. Additionally, Phenol Red could potentially be useful as a differentiation factor. It can also be used as reactant/reag
일반 설명
Phenol Red sodium salt is widely used as a pH indicator. At a pH of 6.4 and below, phenol red solution will have a yellow color. At a pH of 8.2 and above, it will have a red color. It is commonly used in culture media to detect neutral to acidic pH changes.