Mebendazole
MEBENDAZOL · vermox · Methyl (5-benzoyl-1H-benzo[d]iMidazol-2-yl)carbaMate · (5-Benzoyl-1H-benzimidazol-2-yl)carbamicacidmethylester · mbdz · Mebex · lomper · r17635
식별자 및 물리적 특성
| CAS No. | 31431-39-7 |
|---|---|
| 분자식 | C16H13N3O3 |
| 평균 분자량 | 295.29 g/mol |
| 단동위원소 질량 | 295.09569129 g/mol |
| SMILES | COC(=O)Nc1nc2ccc(C(=O)c3ccccc3)cc2[nH]1 |
| InChIKey | OPXLLQIJSORQAM-UHFFFAOYSA-N |
| PubChem CID | 4030 |
| ChEMBL | CHEMBL685 |
| ChEBI | CHEBI:6704 |
| EC No. | 104-806-4 |
| DTXSID | DTXSID4040682 |
화학 및 물리적 성질
| XLogP | 2.8 |
|---|---|
| 극성 표면적 | 84.1 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 22 |
| 형식 전하 | 0 |
| 복잡도 | 423 |
| 녹는점 | 288.5°C |
| 끓는 점 | 436.98°C (rough estimate) |
| 밀도 | 1.1952 (rough estimate) |
| 굴절률 | 1.6500 (estimate) |
| 저장 조건 | Sealed in dry,2-8°C |
| 용해도 | 물, 알코올 및 염화메틸렌에는 거의 녹지 않습니다. |
| 물리적 상태 | Solid |
| pKa(산도 계수) | pKa 3.43/9.93(H2O,t =25,I=0.025) (Uncertain) |
| 색상 | 흰색에서 옅은 베이지까지 |
| 용해도 | 35.4mg/L(25℃) |
| Merck | 14,5768 |
| BRN | 759809 |
| 헨리 상수 | 1.8×1010 mol/(m3Pa) at 25℃, HSDB (2015) |
| BCS Class | 2,4 |
| 주요 응용 | 법의학 및 독성학의약품(소분자) |
| InChI | 1S/C16H13N3O3/c1-22-16(21)19-15-17-12-8-7-11(9-13(12)18-15)14(20)10-5-3-2-4-6-10/h2-9H,1H3,(H2,17,18,19,21) |
| InChIKey | OPXLLQIJSORQAM-UHFFFAOYSA-N |
| SMILES | COC(=O)Nc1nc2cc(ccc2[nH]1)C(=O)c3ccccc3 |
| EPA | Mebendazole (31431-39-7) |
화학적 성질
White Amorphous Powder
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| RTECS 번호 | EY8600000 |
| 운송 번호(UN) | UN 2811 |
| 독성 | LD50 orally: >80 mg/kg in sheep>40 mg/kg in mice, rats and chickens (Van Gelder) |
| 관세 코드 | 29339900 |
| 위험 문구(R) | 22 |
| 위험 표시 | Xn |
| 안전 문구(S) | 36 |
| 위험 등급 | Acute Tox. 4 Oral |
| 저장 분류 | 11 - Combustible Solids |
| 유해 물질 데이터 | 31431-39-7(Hazardous Substances Data) |
용도
개요
Mebendazole is a broad-spectrum anthelmintic that is active against both larval and adult stages of nematodes selectively binding the β-subunit of tubulin, thereby inhibiting intestinal microtubule synthesis in the parasite (IC50 = 0.19 μM for Giardia in vitro). As a tubulin-binding agent, mebendazole also possesses antitumor properties, inducing apoptosis of various human carcinomas both in vitro and in vivo, thus preventing their growth and migration. Furthermore, mebendazole has been used to inhibit hedgehog signaling in cancer cells via suppression of the formation of the primary cilium, a microtubule-based organelle that functions as a signaling hub for hedgehog pathway activation. Additionally, mebendazole has been shown to stabilize the transcriptional activator HIF-1α and its downstream targets, abrogating oxidative neuronal death in primary neurons.
용도
Mebendazole Polymorph C is an Anthelmintic (Nematodes).
일반 설명
White to slightly yellow powder. Pleasant taste. Practically water insoluble.