Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 4069713생성일: 2026년 11월 1일
1-Butyl-3-(2,6-dichlorophenyl)-1-methylurea
1-Butyl-3-(2,6-dichlorophenyl)-1-methylurea · Urea, N-butyl-N'-(2,6-dichlorophenyl)-N-methyl-
https://huagongshe.com/ko/chemical/4069713
식별자 및 물리적 특성
| CAS No. | 60006-12-4 |
|---|
| 분자식 | C12H16Cl2N2O |
|---|
| 평균 분자량 | 275.17 g/mol |
|---|
| 단동위원소 질량 | 274.0639685 g/mol |
|---|
| SMILES | CCCCN(C)C(=O)Nc1c(Cl)cccc1Cl |
|---|
| InChIKey | IKLJHMAVKLAUDB-UHFFFAOYSA-N |
|---|
| PubChem CID | 4069713 |
|---|
| EC No. | 665-908-7 |
|---|
화학 및 물리적 성질
| XLogP | 3.6 |
|---|
| 극성 표면적 | 32.3 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 1 |
|---|
| 회전 가능 결합 수 | 4 |
|---|
| 무거운 원자 수 | 17 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 241 |
|---|
| 끓는 점 | 408.2±45.0 °C(Predicted) |
|---|
| 밀도 | 1.252±0.06 g/cm3(Predicted) |
|---|
| pKa(산도 계수) | 13.23±0.70(Predicted) |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| 신호 어 | Warning |
|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
|---|
