Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-나이트로이미노이미드 아조리딘
2-나이트로이미노이미드 아조리딘 · N-NITROIMINO IMIDAZOLIDINE · N-Nitroimidazolidin-2-imine · Selonsertib Impurity 1 · 2-Nitroaminoimidazoline · Imidacloprid Impurity 8 · 2-Nitroamino-2-imidazoline · Imidacloprid EP Impurity B
식별자 및 물리적 특성
| CAS No. | 5465-96-3 |
|---|---|
| 분자식 | C3H6N4O2 |
| 평균 분자량 | 130.11 g/mol |
| 단동위원소 질량 | 130.04907543 g/mol |
| SMILES | O=[N+]([O-])NC1=NCCN1 |
| InChIKey | DJZWNSRUEJSEEB-UHFFFAOYSA-N |
| PubChem CID | 410042 |
| EC No. | 611-182-1 |
| DTXSID | DTXSID40328417 |
| 현지명 | 2-나이트로이미노이미드 아조리딘 |
화학 및 물리적 성질
| XLogP | -0.8 |
|---|---|
| 극성 표면적 | 82.2 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 148 |
| 녹는점 | 220 °C |
| 끓는 점 | 255.1±23.0 °C(Predicted) |
| 밀도 | 1.81±0.1 g/cm3(Predicted) |
| 저장 조건 | Amber Vial, Refrigerator |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 8.55±0.20(Predicted) |
| 색상 | 옅은 노랑 |
| InChI | InChI=1S/C3H6N4O2/c8-7(9)6-3-4-1-2-5-3/h1-2H2,(H2,4,5,6) |
| InChIKey | DJZWNSRUEJSEEB-UHFFFAOYSA-N |
| SMILES | C1(N[N+]([O-])=O)NCCN=1 |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 30 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 관세 코드 | 2933.29.9000 |
| 기존화학 물질 | 97-3-122 |
용도
용도
2-Nitroamino-2-imidazoline is a neonicotinoid substituents that forms water bridge at nicotinic acetylcholine receptor.