Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
메틸2-(2-플루오로-비페닐-4YL)프로피오네이트
메틸2-(2-플루오로-비페닐-4YL)프로피오네이트 · Flurbiprofen methyl ester · methyl 2-(2-fluoro-[1,1'-biphenyl]-4-yl)propanoate · Methyl Flurbiprofen · Flurbiprofen Impurity H · Flurbiprofen Impurity 45 · Flurbiprofen EP Impurity H · METHYL 2-(2-FLUORO-BIPHENYL-4YL)PROPIONATE
식별자 및 물리적 특성
| CAS No. | 66202-86-6 |
|---|---|
| 분자식 | C16H15FO2 |
| 평균 분자량 | 258.29 g/mol |
| 단동위원소 질량 | 258.10560794 g/mol |
| SMILES | COC(=O)C(C)c1ccc(-c2ccccc2)c(F)c1 |
| InChIKey | CPJBKHZROFMSQM-UHFFFAOYSA-N |
| PubChem CID | 4127 |
| ChEMBL | CHEMBL162300 |
| EC No. | 889-721-7 |
| DTXSID | DTXSID50274416 |
| 현지명 | 메틸2-(2-플루오로-비페닐-4YL)프로피오네이트 |
화학 및 물리적 성질
| XLogP | 4.5 |
|---|---|
| 극성 표면적 | 26.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 299 |
| 녹는점 | 39-40°C |
| 끓는 점 | 337.3±30.0 °C(Predicted) |
| 밀도 | 1.127±0.06 g/cm3(Predicted) |
| 저장 조건 | Refrigerator |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| 색상 | 흰색에서 황백색까지 |
화학적 성질
White Solid
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P271, P301+P317, P304+P340, P319, P330, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 신호 어 | Warning |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
용도
용도
Methyl Flurbiprofen is the prodrug of flurbiprofen. An intermediate for the synthesis of the metabolite of Flurbiprofen, an anti-inflammatory used as an analgesic.