Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
트랜스-3-(2,2-디클로로비닐)-2,2-디메틸시클로프로판카르복실산
트랜스-3-(2,2-디클로로비닐)-2,2-디메틸시클로프로판카르복실산 · Permethrin Impurity 12 · trans-Permethrinic Acid · rac-trans-PerMethrinic Acid · Permethrin Impurity 12（trans-Permethric acid） · TRANS-DCCA UNLABELED 100 UG/ML IN ACETONITRILE · trans-Permethrinic acid 100 μg/mL in Acetonitrile · trans-3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid
식별자 및 물리적 특성
| CAS No. | 55701-03-6 |
|---|---|
| 분자식 | C8H10Cl2O2 |
| 평균 분자량 | 209.07 g/mol |
| 단동위원소 질량 | 208.0057849 g/mol |
| SMILES | CC1(C)[C@@H](C=C(Cl)Cl)[C@@H]1C(=O)O |
| InChIKey | LLMLSUSAKZVFOA-UJURSFKZSA-N |
| PubChem CID | 41539 |
| ChEBI | CHEBI:62528 |
| DTXSID | DTXSID50872759 |
| 현지명 | 트랜스-3-(2,2-디클로로비닐)-2,2-디메틸시클로프로판카르복실산 |
화학 및 물리적 성질
| XLogP | 3.3 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 241 |
| 녹는점 | 95-96.5 °C |
| 끓는 점 | 290.6±30.0 °C(Predicted) |
| 밀도 | 1.433±0.06 g/cm3(Predicted) |
| 저장 조건 | Amber Vial, -20°C Freezer |
| 용해도 | 클로로포름(소량으로 용해), 메탄올(약간 용해됨) |
| pKa(산도 계수) | 4.09±0.33(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 흰색에서 황백색까지 |
| 안정성 | 감광성 |
| EPA | Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, (1R,3S)-rel- (59042-50-1) |
용도
용도
trans-Permethrinic acid is a potent insecticide used in the agricultural industry to eliminate unwanted pests from crops. trans-Permethrinic acid is also metabolite of pyrethroid compounds, a group of pesticides that are relatively low toxicity (to organisms that are not intended to be targeted) and biodegradable.