2-(Octanoylamino)benzoic acid

HCID 4157220CAS 72619-72-8

기본 정보

표준 SMILES: CCCCCCCC(=O)Nc1ccccc1C(=O)O
InChIKey: DIBJPKPIMHBNDD-UHFFFAOYSA-N
분자식: C15H21NO3
평균 분자량: 263.33 g/mol
단동위원소 질량: 263.15214353

개요

N-octanoylanthranilic acid is an amidobenzoic acid resulting from the formal condensation of the carboxy group of octanoic acid with the amino group of anthranilic acid. It is functionally related to an octanoic acid and an anthranilic acid. It is a conjugate acid of a N-octanoylanthranilate.

이름 및 식별자

우선 이름: 2-(Octanoylamino)benzoic acid
IUPAC: 2-(octanoylamino)benzoic acid

이름 및 동의어

2-(octanoylamino)benzoic acid2-octanamidobenzoic acidn-octanoylanthranilic acid72619-72-8N-octanoylanthranilateN-n-octanoylanthranilic acidAO-548/41128890SCHEMBL2183707CHEBI:143902DIBJPKPIMHBNDD-UHFFFAOYSA-NDTXSID6013875062-[(1-Oxooctyl)amino]benzoic acid

이름 더 보기

C23184JWH