보란-터트-뷰틸아민 착화합물
보란-터트-뷰틸아민착화합물 · TERT-BUTYLAMINE BORANE · BORANE-TERT-BUTYLAMINE COMPLEX · Borane tert-butyL · BORANE-TERT-BUTYLAMINE · DDK314 · NSC 114045 · amine compL
식별자 및 물리적 특성
| CAS No. | 7337-45-3 |
|---|---|
| 분자식 | C4H14BN |
| 평균 분자량 | 86.97 g/mol |
| 단동위원소 질량 | 87.1219296 g/mol |
| SMILES | [BH3-][NH2+]C(C)(C)C |
| InChIKey | HJUZMIDACSQXPA-UHFFFAOYSA-N |
| PubChem CID | 419331 |
| DTXSID | DTXSID50994086 |
| 현지명 | 보란-터트-뷰틸아민 착화합물 |
화학 및 물리적 성질
| 극성 표면적 | 16.6 |
|---|---|
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 6 |
| 형식 전하 | 0 |
| 복잡도 | 37.3 |
| 녹는점 | 98-100 °C (dec.)(lit.) |
| 밀도 | 0,87 g/cm3 |
| 저장 조건 | Refrigerator |
| 용해도 | 27g/L |
| 물리적 상태 | 가루 |
| 색상 | 흰색에서 황백색까지 |
| 용해도 | 물(20°C에서 27g/L) 및 메탄올에 용해됩니다. |
| BRN | 4134905 |
| InChI | InChI=1S/C4H11N.BH3/c1-4(2,3)5/h5H2,1-3H31H3 |
| InChIKey | GKFJEDWZQZKYHV-UHFFFAOYSA-N |
| SMILES | N([H])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H].B |
| EPA | Boron, trihydro(2-methyl-2-propanamine)-, (T-4)- (7337-45-3) |
화학적 성질
white to off-white crystalline powder
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | EO3900000 |
| 운송 번호(UN) | UN 2811 6.1/PG 3 |
| 관세 코드 | 29299090 |
| 위험 문구(R) | 21-25-36/37/38 |
| 위험 표시 | T |
| 안전 문구(S) | 26-36/37-45 |
| 포장분류 | III |
| 위험 등급 | 4.1Acute Tox. 3 DermalAcute Tox. 3 OralAquatic Chronic 2Eye Irrit. 2Skin Irrit. 2 |
| 기존화학 물질 | KE-04194 |
| F 고인화성물질 | 9 |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
Borane-tert-butylamine complex is used in stereoselective reduction of a steroidal ketone and for a review of amine boranes as selective reducing and hydroborating agents. It is also used as strong co-reducing agent in the syntheses of copper (I) oxide nanoparticles, diphosphine-protected gold nanocluster and 4-acetoxycinnamyl alcohols.
일반 설명
Borane tert-butylamine complex is a mild reducing agent. It participates in the selective reduction of aldehydes and ketones to corresponding alcohol. It takes part as a reducing agent in the synthesis of monodisperse palladium nanoparticles (Pd NPs), monodisperse gold (Au) nanoparticles and carbon-supported Pd electrocatalysts.