미녹시딜
미녹시딜 · 6-(피페리다이닐)-2,4-피리미딘다이아민-3-옥사이드(미녹시딜),그염류및유도체 · Minoxidil Base · pdp · 2,4-diamino-6-piperidinopyrimidine3-n-oxide · minoxidi · Minoxidil powder · 4-pyrimidinediamine,6-(1-piperidinyl)-3-oxide
식별자 및 물리적 특성
| CAS No. | 38304-91-5 |
|---|---|
| 분자식 | C9H15N5O |
| 평균 분자량 | 209.25 g/mol |
| 단동위원소 질량 | 209.12766012 g/mol |
| SMILES | N=c1nc(N2CCCCC2)cc(N)n1O |
| InChIKey | ZIMGGGWCDYVHOY-UHFFFAOYSA-N |
| PubChem CID | 4201 |
| ChEMBL | CHEMBL1372483 |
| ChEBI | CHEBI:6942 |
| DTXSID | DTXSID301372970 |
| 현지명 | 미녹시딜 |
화학 및 물리적 성질
| XLogP | 1.2 |
|---|---|
| 극성 표면적 | 88.9 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 329 |
| 녹는점 | 272-274 °C (dec.) (lit.) |
| 끓는 점 | 348.61°C (rough estimate) |
| 밀도 | 1.1651 (rough estimate) |
| 굴절률 | 1.7610 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | 물에 약간 용해되고 메탄올과 프로필렌 글리콜에 용해됩니다. |
| pKa(산도 계수) | 4.61(at 25℃) |
| 물리적 상태 | Solid |
| 색상 | 하얀색 |
| 용해도 | 물(2.2 mg/ml), 100% 에탄올(29 mg/ml), 프로필렌 글리콜, 아세톤, DMSO(6.5 mg/ml) 및 메탄올에 용해됩니다. |
| Merck | 14,6203 |
| BCS Class | 3 |
| 안정성 | 최대 3개월 동안 -20°C에서 DMSO 또는 에탄올에 보관 |
| 화장품 원료 기능 | 헤어 스타일링헤어 컨디셔닝 |
| InChI | 1S/C9H15N5O/c10-7-6-8(12-9(11)14(7)15)13-4-2-1-3-5-13/h6,11,15H,1-5,10H2 |
| InChIKey | ZFMITUMMTDLWHR-UHFFFAOYSA-N |
| SMILES | NC1=CC(=NC(=N)N1O)N2CCCCC2 |
| NIST | Minoxidil(38304-91-5) |
화학적 성질
White Crystalline Solid
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| RTECS 번호 | UV8200000 |
| 독성 | LD50 in rats, mice (mg/kg): 49, 51 i.v. (Carlson, Feenstra) |
| 관세 코드 | 29335990 |
| 위험 문구(R) | 22-36/37/38-26/27/28 |
| 위험 표시 | Xn,T+ |
| 안전 문구(S) | 26-36-45-36/37/39-22 |
| 기존화학 물질 | KE-01301 |
| 위험 등급 | Acute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
| 유해 물질 데이터 | 38304-91-5(Hazardous Substances Data) |
용도
개요
Minoxidil is a peripheral vasodilator that directly relaxes vascular smooth musculature, thus, lowering systolic and diastolic pressure. Its action is linked to the activation of calcium channels. Open calcium channels cause hyperpolarization of smooth muscle cells, which in turn, reduces the flow of calcium ions into the cell, which is necessary for supporting vascular tonicity. However, when taking minoxidil, tachycardia, elevated renin secretion, and water and sodium ion retention all appear simultaneously with hypotension.
용도
Used as an antihypertensive and antialopecia agent. Minoxidil activates ATP-activated K+ channels
일반 설명
Minoxidil, 2,4-diamino-6-piperidinopyrimidine-3-oxide . It is converted to minoxidil sulfate in the liver bya sulfotransferase enzyme.The antihypertensive properties of minoxidil are similarto those of hydralazine hydrochloride, in that minoxidil candecrease arteriolar vascular resistance. Minoxidil exerts itsvasodilatory action by a direct effect on arteriolar smoothmuscle and appears to have no effect on the CNS or on theadrenergic nervous system in animals. The serum half-lifeis 4.5 hours, and the antihypertensive effect may last up to24 hours.