Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4,6-Dichloro-2-(methylsulfanyl)pyrimidine-5-carbonitrile
5-Cyano-4,6-dichloro-2-(methylthio)pyrimidine · 2-(Methylthio)-4,6-dichloro-5-cyanopyrimidine · ,6-DICHLORO-2-(METHYLTHIO)PYRIMIDINE-5-CARBONITRILE · 4,6-Dichloro-2-(methylthio)pyrimidine-5-carbonitrile · 4,6-Dichloro-2-(methylthio)-5-pyrimidinecarbonitrile · 5-PyriMidinecarbonitrile, 4,6-dichloro-2-(Methylthio)- · 4,6-DICHLORO-2-METHYLSULFANYL-PYRIMIDINE-5-CARBONITRILE · 4,6-DICHLORO-2-(METHYLTHIO)PYRIMIDINE-5-CARBONITRILE ISO 9001：2015 REACH
식별자 및 물리적 특성
| CAS No. | 33097-13-1 |
|---|---|
| 분자식 | C6H3Cl2N3S |
| 평균 분자량 | 220.08 g/mol |
| 단동위원소 질량 | 218.94247346 g/mol |
| SMILES | CSc1nc(Cl)c(C#N)c(Cl)n1 |
| InChIKey | GLOOTGZVAHKTJS-UHFFFAOYSA-N |
| PubChem CID | 4201620 |
| EC No. | 694-520-0 |
| DTXSID | DTXSID80400786 |
화학 및 물리적 성질
| XLogP | 2.7 |
|---|---|
| 극성 표면적 | 74.9 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 192 |
| 녹는점 | 103-105°C |
| 끓는 점 | 367.3±37.0 °C(Predicted) |
| 밀도 | 1.58±0.1 g/cm3(Predicted) |
| 저장 조건 | Inert atmosphere,2-8°C |
| 용해도 | 클로로포름, 에틸아세테이트에 용해됨 |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | -7.56±0.39(Predicted) |
| 색상 | 연노랑 |
| InChI | InChI=1S/C6H3Cl2N3S/c1-12-6-10-4(7)3(2-9)5(8)11-6/h1H3 |
| InChIKey | GLOOTGZVAHKTJS-UHFFFAOYSA-N |
| SMILES | C1(SC)=NC(Cl)=C(C#N)C(Cl)=N1 |
화학적 성질
Light Yellow Solid
안전 및 규제
| GHS 분류 | DangerH301 (95%): Toxic if swallowed [Danger Acute toxicity, oral]P260, P264, P270, P280, P301+P316, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P330, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (95%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 2923 |
| 관세 코드 | 2933599590 |
| 위험 문구(R) | 25-34 |
| 위험 표시 | T,C |
| 안전 문구(S) | 26-36/37/39-45 |
| 포장분류 | Ⅲ |
| 위험 등급 | Acute Tox. 3 OralSkin Corr. 1B |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
4,6-Dichloro-2-(methylthio)pyrimidine-5-carbonitrile (cas# 33097-13-1) is a compound useful in organic synthesis.