Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
6,8-디설파닐옥타노익산
6,8-디설파닐옥타노익산 · DHLA · dihydrolipoate · LIPOIC ACID, REDUCED · 6,8-DIMERCAPTO-OCTANOIC ACID · usafxr-12 · USAF XR-12 · Dihydroliponsure
식별자 및 물리적 특성
| CAS No. | 462-20-4 |
|---|---|
| 분자식 | C8H16O2S2 |
| 평균 분자량 | 208.3 g/mol |
| 단동위원소 질량 | 208.05917175 g/mol |
| SMILES | O=C(O)CCCCC(S)CCS |
| InChIKey | IZFHEQBZOYJLPK-UHFFFAOYSA-N |
| PubChem CID | 421 |
| ChEMBL | CHEMBL1235647 |
| ChEBI | CHEBI:18047 |
| EC No. | 610-288-5 |
| DTXSID | DTXSID50861946 |
| 현지명 | 6,8-디설파닐옥타노익산 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 39.3 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 7 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 128 |
| Physical Description | Solid |
| 녹는점 | 62 °C |
| 끓는 점 | 161.5 °C(Press: 0.7 Torr) |
| 밀도 | 1.132 g/cm3 |
| 증기압 | 0Pa at 25℃ |
| 굴절률 | 1.5220-1.5260 |
| 저장 조건 | +2C to +8C |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | 4.74±0.10(Predicted) |
| 색상 | 연노랑 |
| InChI | InChI=1S/C8H16O2S2/c9-8(10)4-2-1-3-7(12)5-6-11/h7,11-12H,1-6H2,(H,9,10) |
| InChIKey | IZFHEQBZOYJLPK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCC(S)CCS |
| LogP(분배 계수) | 1.9 at 20℃ |
| 표면장력 | 53.6mN/m at 1.02g/L and 21℃ |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 26-03-2021 https://echa.europa.eu/registration-dossier/-/registered-dossier/11996 |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | RH0525000 |
| 관세 코드 | 2930.90.4950 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 등급 | Acute Tox. 4 OralAquatic Chronic 2Eye Dam. 1Skin Irrit. 2Skin Sens. 1 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
γ-Lipoic Acid, is a metabolite of α-Lipoic Acid (L468730), which is a over-the-counter nutritional supplements, that has been used as antioxidant. It is also fat-metabolism stimulator, and thus used a "weight loss" and "energy" supplement.