4-(2-(2-Ethyl-5'-(6-hydroxy-6-(hydroxymethyl)-3,5-dimethyloxan-2-yl)-3'-methyl(2,2'-bioxolan)-5-yl)-9-hydroxy-2,8-dimethyl-1,6-dioxaspiro(4.5)decan-7-yl)-3-methoxy-2-methylpentanoic acid
Coban · RUMENSIN · Coban45 · Sodiummonensin · Monomycin sodium · Monensinsodiumsal · MONENSINSODIUM,USP · Monensin sodium 40%
식별자 및 물리적 특성
| CAS No. | 22373-78-0 |
|---|---|
| 분자식 | C36H62O11 |
| 평균 분자량 | 670.9 g/mol |
| 단동위원소 질량 | 670.42921279 g/mol |
| SMILES | CCC1(C2OC(C3OC(O)(CO)C(C)CC3C)CC2C)CCC(C2(C)CCC3(CC(O)C(C)C(C(C)C(OC)C(C)C(=O)O)O3)O2)O1 |
| InChIKey | GAOZTHIDHYLHMS-UHFFFAOYSA-N |
| PubChem CID | 4243 |
| ChEMBL | CHEMBL4788880 |
| DTXSID | DTXSID10860197 |
화학 및 물리적 성질
| XLogP | 4.2 |
|---|---|
| 극성 표면적 | 153 |
| 수소 결합 공여자 수 | 4 |
| 수소 결합 수용자 수 | 11 |
| 회전 가능 결합 수 | 10 |
| 무거운 원자 수 | 47 |
| 형식 전하 | 0 |
| 복잡도 | 1,110 |
| 녹는점 | 267-269 C |
| 저장 조건 | 2-8°C |
| 용해도 | 50mg/ml의 메탄올에 용해됨 |
| 물리적 상태 | 황백색에서 베이지색 고체 |
| 색상 | 하얀색 |
| BRN | 4122200 |
| 안정성 | 제공된 대로 구매일로부터 2년 동안 안정적입니다. DMSO의 솔루션은 -20°C에서 최대 1개월 동안 보관할 수 있습니다. |
| InChIKey | XOIQMTLWECTKJL-BEMBKCOJSA-M |
| LogP(분배 계수) | 3.716 (est) |
| EPA | Monensin, monosodium salt (22373-78-0) |
화학적 성질
LIGHT CREAM AMORPHOUS POWDER
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| RTECS 번호 | JH2830000 |
| 운송 번호(UN) | UN 3462 6.1/PG 2 |
| 관세 코드 | 29419090 |
| 위험 문구(R) | 25-26/27/28 |
| 위험 표시 | T,T+ |
| 안전 문구(S) | 36/37/39-45-22 |
| 포장분류 | II |
| 위험 등급 | 6.1(a)Acute Tox. 2 OralAquatic Chronic 2Eye Irrit. 2STOT RE 2 |
| 저장 분류 | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
용도
개요
Monensin is a naturally occuring ionophorous antibiotic that preferentially forms complexes with monovalent cations to enable transport across lipid membranes. Through its ability to affect pH and the sodium-potassium balance of a cell, monensin can induce cell death in Gram-positive bacteria such as Micrococcus, Bacillus, and Staphylococcus (MICs = 1-12.5 μg/ml), reduce proliferation of P. falciparum and Coccicdium protozoa, and also prevent replication of certain viruses.
용도
Monensin sodium salt is used in potentiometric and spectroscopic studies of alkali metal ion complexes. Monensin (Na) is a polyether small molecule ionophore, capable of forming stable complexes to monovalent cations with specific affinity for Na+. Monensin presents a highly lipophilic scaffold around the bound ion, allowing movement of the complex through the lipid bilayer and consequent transport of the ion out of the cell. Excessive flux of ions out of the cell produces a cytotoxic effect and generates the antibiotic properties of Monensin.
일반 설명
Monensin is a polyether ionophoric antibiotic, which is produced by Streptomyces cinnamonensis. It is used to treat bacterial, fungal and parasitic infections. Monensin prevents the growth of colon cancer cells. It facilitates the transport of sodium and potassium ions between intracellular and extracellular spaces. Monensin prevents coccidiosisin poultry production.