Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Entinostat
Rivipansel · CS-189 · MS 2275 · Entenot · MS 275-27 · Nsc706995 · entinostat · MS275
식별자 및 물리적 특성
| CAS No. | 209783-80-2 |
|---|---|
| 분자식 | C21H20N4O3 |
| 평균 분자량 | 376.4 g/mol |
| 단동위원소 질량 | 376.1535405 g/mol |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNC(=O)OCc2cccnc2)cc1 |
| InChIKey | INVTYAOGFAGBOE-UHFFFAOYSA-N |
| PubChem CID | 4261 |
| ChEMBL | CHEMBL27759 |
| ChEBI | CHEBI:132082 |
| EC No. | 630-693-0 |
| DTXSID | DTXSID0041068 |
화학 및 물리적 성질
| XLogP | 2 |
|---|---|
| 극성 표면적 | 106 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 7 |
| 무거운 원자 수 | 28 |
| 형식 전하 | 0 |
| 복잡도 | 508 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| LogP(분배 계수) | 1.26 |
| 녹는점 | 159-160 ºC |
| 끓는 점 | 566.7±50.0 °C(Predicted) |
| 밀도 | 1.315 |
| 저장 조건 | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| 용해도 | DMSO: 38mg/mL, 가용성 |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 11.32±0.46(Predicted) |
| 색상 | 옅은 노랑 |
| 안정성 | 제공된 대로 구매일로부터 1년 동안 안정적입니다. DMSO의 솔루션은 최대 1주일 동안 -20°에서 보관할 수 있습니다. |
| InChI | InChI=1S/C21H20N4O3/c22-18-5-1-2-6-19(18)25-20(26)17-9-7-15(8-10-17)13-24-21(27)28-14-16-4-3-11-23-12-16/h1-12H,13-14,22H2,(H,24,27)(H,25,26) |
| InChIKey | INVTYAOGFAGBOE-UHFFFAOYSA-N |
| SMILES | C(OCC1=CC=CN=C1)(=O)NCC1=CC=C(C(NC2=CC=CC=C2N)=O)C=C1 |
화학적 성질
Yellow Solid
안전 및 규제
| GHS 분류 | DangerH301 (98.6%): Toxic if swallowed [Danger Acute toxicity, oral]P203, P261, P264, P264+P265, P270, P271, P280, P301+P316, P302+P352, P304+P340, P305+P351+P338, P318, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 74 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (98.6%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2811 6.1 / PGIII |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 36/37/38-62-48/25-25-61 |
| 위험 표시 | Xi,T |
| 안전 문구(S) | 26-36-45 |
| 위험 등급 | Acute Tox. 3 OralRepr. 1A |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
개요
Entinostat (SNDX-275, MS-275) belongs to benzamide class HDACi and inhibits HDAC1 and 2, 3 and 9 and has low effect against HDAC4, 6, 7 and 8 (Khan et al. 2007). Entinostat is in phase II clinical trial for treatment of Hodgkin's lymphoma and advanced breast cancer (in combination with aromatase inhibitors) and metastatic lung cancer (in combination with erlotinib).