Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,6-Dichloropyridazine-4-carboxylic acid
IFLAB-BB F3111-0070 · 3,6-DICHLOROPYRIDAZINE-4-CA · 3,6-Dichloro-4-pyridazine... · 3,6-Dichloropyridazine-4-Carbo · 4-Carboxy-3,6-dichloropyridazine · 3,6-DICHLOROPYRIDAZINE-4-CARBOXYLIC · 3,6-DICHLOROPYRIDAZINECARBOXYLIC ACID · 6-Dichloropyridazine-4-carboxylic acid
식별자 및 물리적 특성
| CAS No. | 51149-08-7 |
|---|---|
| 분자식 | C5H2Cl2N2O2 |
| 평균 분자량 | 192.98 g/mol |
| 단동위원소 질량 | 191.94933266 g/mol |
| SMILES | O=C(O)c1cc(Cl)nnc1Cl |
| InChIKey | FRCXPDWDMAYSCE-UHFFFAOYSA-N |
| PubChem CID | 433804 |
| EC No. | 628-653-2 |
| DTXSID | DTXSID20330952 |
화학 및 물리적 성질
| XLogP | 1.3 |
|---|---|
| 극성 표면적 | 63.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 167 |
| 녹는점 | 142 °C (dec.) (lit.) |
| 끓는 점 | 424.8±40.0 °C(Predicted) |
| 밀도 | 1.718±0.06 g/cm3(Predicted) |
| 저장 조건 | Inert atmosphere,Store in freezer, under -20°C |
| pKa(산도 계수) | 0.59±0.32(Predicted) |
| 물리적 상태 | 분말 또는 결정성 분말 |
| 색상 | 흰색에서 황백색까지 |
| BRN | 610056 |
| InChI | InChI=1S/C5H2Cl2N2O2/c6-3-1-2(5(10)11)4(7)9-8-3/h1H,(H,10,11) |
| InChIKey | FRCXPDWDMAYSCE-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NN=C(Cl)C=C1C(O)=O |
화학적 성질
White solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 50 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29339900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3,6-Dichloropyridazine-4-carboxylic acid has been used in the synthesis of α-(halohetaroyl)-2-azahetarylacetonitriles.