Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
에틸2-(2-아미노티아졸-4-일)글리옥실레이트
에틸2-(2-아미노티아졸-4-일)글리옥실레이트 · EAOA · CEFA-006 · )-2-oxoacetate · 2-(2-Amino-4-thiazoL · Ethyl-2-(2-AMinothiazol-4-yl)- · Ethyl Aminothiazole Glyoxylate · Ethyl 2-amino-4-thiazoleglyoxylate
식별자 및 물리적 특성
| CAS No. | 64987-08-2 |
|---|---|
| 분자식 | C7H8N2O3S |
| 평균 분자량 | 200.22 g/mol |
| 단동위원소 질량 | 200.02556312 g/mol |
| SMILES | CCOC(=O)C(=O)c1csc(N)n1 |
| InChIKey | XNVRKLCQBZTGNA-UHFFFAOYSA-N |
| PubChem CID | 4356513 |
| EC No. | 682-387-1 |
| DTXSID | DTXSID00402308 |
| 현지명 | 에틸2-(2-아미노티아졸-4-일)글리옥실레이트 |
화학 및 물리적 성질
| XLogP | 1 |
|---|---|
| 극성 표면적 | 111 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 222 |
| 녹는점 | 150-152 °C(lit.) |
| 끓는 점 | 361.6±15.0 °C(Predicted) |
| 밀도 | 1.405±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2–8 °C |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 1.35±0.10(Predicted) |
| 색상 | 밝은 노란색에서 노란색까지 |
| InChI | InChI=1S/C7H8N2O3S/c1-2-12-6(11)5(10)4-3-13-7(8)9-4/h3H,2H2,1H3,(H2,8,9) |
| InChIKey | XNVRKLCQBZTGNA-UHFFFAOYSA-N |
| SMILES | C1(N=C(N)SC=1)C(=O)C(=O)OCC |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 관세 코드 | 2934100090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
용도
용도
Ethyl 2-(2-Aminothiazol-4-yl)glyoxylate is used in the synthesis of antibacterial compounds. Also used in the synthesis of antiallergic and antiinflammatory agents, as glycolic amide derivatives.