Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
P-아지도아세토페논
P-아지도아세토페논 · P-AZIDOACETOPHENONE · 4'-AZIDOACETOPHENONE · 1-(4-Azidophenyl)ethanone · 1-(4-azidophenyl)ethan-1-one
식별자 및 물리적 특성
| CAS No. | 20062-24-2 |
|---|---|
| 분자식 | C8H7N3O |
| 평균 분자량 | 161.16 g/mol |
| 단동위원소 질량 | 161.05891186 g/mol |
| SMILES | CC(=O)c1ccc(N=[N+]=[N-])cc1 |
| InChIKey | HYRIDYFBEXCCIA-UHFFFAOYSA-N |
| PubChem CID | 4452691 |
| EC No. | 800-518-4 |
| DTXSID | DTXSID20403438 |
| 현지명 | P-아지도아세토페논 |
화학 및 물리적 성질
| XLogP | 2.5 |
|---|---|
| 극성 표면적 | 31.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 212 |
| 녹는점 | 39-40°C |
| 저장 조건 | Amber Vial, -20°C Freezer, Under Inert Atmosphere |
| 용해도 | 클로로포름, 아세트산에틸(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| 색상 | 연한 노란색에서 갈색까지 |
화학적 성질
Yellow Powder
안전 및 규제
| GHS 분류 | DangerH301 (66.7%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P262, P264, P264+P265, P270, P271, P280, P301+P316, P302+P352, P304+P340, P305+P351+P338, P316, P319, P321, P330, P332+P317, P337+P317, P361+P364, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (66.7%) |
| 신호 어 | Warning |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H315 |