Epothilone B
EPOTHILONE · Patupilone · Epothilon B · (1S,3S,7S,10R,11S,12S,16R)-7,11-Dihydroxy-8,8,10,12,16-pentamethyl-3-[(1E)-1-methyl-2-(2-methyl-4-thiazolyl)ethenyl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione · CS-556 · EPO 906A · atupilone · Ebomycin B
식별자 및 물리적 특성
| CAS No. | 152044-54-7 |
|---|---|
| 분자식 | C27H41NO6S |
| 평균 분자량 | 507.7 g/mol |
| 단동위원소 질량 | 507.26545903 g/mol |
| SMILES | C/C(=C\c1csc(C)n1)[C@@H]1C[C@@H]2O[C@]2(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChIKey | QXRSDHAAWVKZLJ-PVYNADRNSA-N |
| PubChem CID | 448013 |
| ChEMBL | CHEMBL94657 |
| ChEBI | CHEBI:31550 |
| EC No. | 604-822-6 |
| DTXSID | DTXSID4046862 |
화학 및 물리적 성질
| XLogP | 4.2 |
|---|---|
| 극성 표면적 | 137 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 8 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 35 |
| 형식 전하 | 0 |
| 복잡도 | 815 |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| 지질 | Polyketides [PK] -> Macrolides and lactone polyketides [PK04] |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | 95-97°C |
| 끓는 점 | 680.2±55.0 °C(Predicted) |
| 밀도 | 1.136 |
| 저장 조건 | Store at -20°C |
| 용해도 | DMSO(최대 40mg/ml) 또는 에탄올(최대 35mg/ml)에 용해됩니다. |
| 물리적 상태 | 흰색에서 회백색 고체 |
| pKa(산도 계수) | 13.57±0.70(Predicted) |
| 색상 | 무색의 |
| 생물학적 소스 | Sorangium cellulosum |
| 안정성 | 제공된 대로 구매일로부터 2년 동안 안정적입니다. DMSO 또는 에탄올 용액은 -20°에서 최대 1개월 동안 보관할 수 있습니다. |
| InChIKey | QXRSDHAAWVKZLJ-PVYNADRNSA-N |
| SMILES | [C@]12([H])[C@](C)(O1)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O[C@H](/C(/C)=C/C1=CSC(C)=N1)C2 |
화학적 성질
White Powder
안전 및 규제
| GHS 분류 | DangerH300 (75%): Fatal if swallowed [Danger Acute toxicity, oral]P203, P260, P261, P262, P264, P264+P265, P270, P271, P272, P273, P280, P301+P316, P302+P352, P304+P340, P305+P354+P338, P316, P317, P318, P319, P321, P330, P332+P317, P333+P317, P361+P364, P362+P364, P391, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 4 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | 4,17-Dioxabicyclo14.1.0heptadecane-5,9-dione, 7,11-dihydroxy-8,8,10,12,16-pentamethyl-3-(1E)-1-methyl-2-(2-methyl-4-thiazolyl)ethenyl-, (1S,3S,7S,10R,11S,12S,16R)-: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
| Hazard Classes and Categories | Acute Tox. 1 (75%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29419090 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Epothilones are polyketide natural products that inhibit cancer cells by a mechanism similar to paclitaxel, and also are effective against paclitaxel-resistant tumours. Epothilone B is what is known as a microtubule stabilizer. When a cell divides, the chromosomes that will end up in each cell are separated by thin filaments called microtubules. Normally these microtubules then break down as the cell division progresses. This class of cytotoxic chemo drugs prevents that break down and thus prevents cells from completing division.
일반 설명
Epothilones has antimitotic properties. It prevents microtubule depolymerization and competitively blocks paclitaxel binding to microtubules. Epothilone B is used to treat metastatic breast cancer (MBC).