Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
m-카르보란-1,7-디카르복실산
m-카르보란-1,7-디카르복실산 · 1,7-dicarba-closo-dodecarborane · m-Carborane-1,7-dicarboxylic acid
식별자 및 물리적 특성
| CAS No. | 50571-15-8 |
|---|---|
| 분자식 | C4H2B10O4 |
| 평균 분자량 | 222.2 g/mol |
| 단동위원소 질량 | 224.08836 g/mol |
| SMILES | O=C(O)C12[B][B][B][B][B][B][B][B]C(C(=O)O)([B]1)[B]2 |
| InChIKey | BREAAVUQZUTQDB-UHFFFAOYSA-N |
| PubChem CID | 45050575 |
| EC No. | 635-457-0 |
| 현지명 | m-카르보란-1,7-디카르복실산 |
화학 및 물리적 성질
| 극성 표면적 | 74.6 |
|---|---|
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 318 |
| 물리적 상태 | solid |
| InChI | 1S/C4H12B10O4/c15-1(16)3-5-4(6-3,2(17)18)8-10-12-14-13-11-9-7-3/h5-14H,(H,15,16)(H,17,18) |
| InChIKey | BREAAVUQZUTQDB-UHFFFAOYSA-N |
| SMILES | OC(=O)C12BBBBBBBBC(B1)(B2)C(O)=O |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 위험 문구(R) | 22 |
| 위험 표시 | Xn |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
m-Carborane-1,7-dicarboxylic acid is used in the preparation of divalent-metal carboranedicarboxylates for boron-neutron capture therapy.