Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
옥타플루오로이소부틸에테르메틸
옥타플루오로이소부틸에테르메틸 · OCTAFLUOROISOBUTYLMETHYLETHER · Octafluoroisobutyl ether methyl
식별자 및 물리적 특성
| CAS No. | 382-26-3 |
|---|---|
| 분자식 | C5H4F8O |
| 평균 분자량 | 232.07 g/mol |
| 단동위원소 질량 | 232.01344051 g/mol |
| SMILES | COC(F)(F)C(C(F)(F)F)C(F)(F)F |
| InChIKey | AQHKYFLVHBIQMS-UHFFFAOYSA-N |
| PubChem CID | 45459 |
| EC No. | 609-534-4 |
| DTXSID | DTXSID40880146 |
| 현지명 | 옥타플루오로이소부틸에테르메틸 |
화학 및 물리적 성질
| XLogP | 3.3 |
|---|---|
| 극성 표면적 | 9.2 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 9 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 177 |
| PFAS | PFAS -> Other/unspecifiedPFAS -> PFAS identified in REACH Regulation EC No. 1272/2008PFAS -> OECD CategoryPFAS -> Suspected persistent, mobile, toxic (PMT) PFAS or PFAS-like compounds |
안전 및 규제
| GHS 분류 | DangerH225 (33.3%): Highly Flammable liquid and vapor [Danger Flammable liquids]P203, P210, P233, P240, P241, P242, P243, P260, P261, P262, P264, P270, P271, P272, P280, P284, P301+P316, P302+P352, P303+P361+P353, P304+P340, P316, P318, P320, P321, P330, P333+P317, P361+P364, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 19-03-2019 https://echa.europa.eu/registration-dossier/-/registered-dossier/7493 |
| Hazard Classes and Categories | Flam. Liq. 2 (33.3%) |