Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-(트리메틸실릴)페닐보론산
3-(트리메틸실릴)페닐보론산 · AKOS BRN-0601 · 3-TRIMETHYLSILYLBENZENEBORONIC ACID · 3-(TRIMETHYLSILYL)PHENYLBORONIC ACID · m-(Trimethylsilyl)phenylboronic acid · 3-(trimethylsilyl)phenylboronic acid 98% · B-[3-(Trimethylsilyl)phenyl]boronic acid · 3- (trimethyl silicon) phenylboronic acid
식별자 및 물리적 특성
| CAS No. | 177171-16-3 |
|---|---|
| 분자식 | C9H15BO2Si |
| 평균 분자량 | 194.11 g/mol |
| 단동위원소 질량 | 194.09343665 g/mol |
| SMILES | C[Si](C)(C)c1cccc(B(O)O)c1 |
| InChIKey | REMKRZLFPLDTKR-UHFFFAOYSA-N |
| PubChem CID | 4577181 |
| EC No. | 804-982-9 |
| DTXSID | DTXSID30404456 |
| 현지명 | 3-(트리메틸실릴)페닐보론산 |
화학 및 물리적 성질
| 극성 표면적 | 40.5 |
|---|---|
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 167 |
| 녹는점 | 145-150 °C (lit.) |
| 끓는 점 | 290℃ |
| 밀도 | 1.01 |
| 인화점 | 129℃ |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 8.73±0.10(Predicted) |
| 색상 | 흰색에서 거의 흰색 |
| InChI | InChI=1S/C9H15BO2Si/c1-13(2,3)9-6-4-5-8(7-9)10(11)12/h4-7,11-12H,1-3H3 |
| InChIKey | REMKRZLFPLDTKR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC([Si](C)(C)C)=C1)(O)O |
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 33.3% (1 of 3) of reports.WarningH302 (33.3%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (33.3%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29319090 |
| 저장 분류 | 13 - Non Combustible Solids |
용도
용도
3-(Trimethylsilyl)phenylboronic acid can be used:To prepare a 2-phenylpyridine ligand, which is used in the synthesis of Ir(III) complex applicable in the OLEDs.As an intermediate in the preparation of biphenyl derived amino acids.As a starting material for the synthesis of triphenylene-based electron transport materials.