Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-플루오로-6-메톡시아닐린
2-플루오로-6-메톡시아닐린 · -FLUORO-6-METHOXYANILINE · 2-FLUORO-6-METHOXYANILINE · 2-fluoro-6-methoxybenzenamine · 2-Fluoro-6-methoxy-phenylamine · Benzenamine, 2-fluoro-6-methoxy- · 2-Amino-3-fluoroanisole, 6-Fluoro-o-anisidine · 2-AMino-3-fluoroanisole[2-Fluoro-6-Methoxyaniline]
식별자 및 물리적 특성
| CAS No. | 446-61-7 |
|---|---|
| 분자식 | C7H8FNO |
| 평균 분자량 | 141.14 g/mol |
| 단동위원소 질량 | 141.0589921 g/mol |
| SMILES | COc1cccc(F)c1N |
| InChIKey | VHHKZASLPJMWJI-UHFFFAOYSA-N |
| PubChem CID | 459253 |
| EC No. | 806-627-3 |
| DTXSID | DTXSID90332620 |
| 현지명 | 2-플루오로-6-메톡시아닐린 |
화학 및 물리적 성질
| XLogP | 1.3 |
|---|---|
| 극성 표면적 | 35.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 110 |
| 끓는 점 | 208 °C(Press: 756 Torr) |
| 밀도 | 1.176±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2–8 °C |
| pKa(산도 계수) | 3.15±0.10(Predicted) |
| 물리적 상태 | 약간 점성이 있는 액체 |
| 색상 | Clear, peach/khaki |
| InChI | InChI=1S/C7H8FNO/c1-10-6-4-2-3-5(8)7(6)9/h2-4H,9H2,1H3 |
| InChIKey | VHHKZASLPJMWJI-UHFFFAOYSA-N |
| SMILES | C1(N)=C(OC)C=CC=C1F |
화학적 성질
black liquid
안전 및 규제
| GHS 분류 | WarningH302+H312+H332 (25%): Harmful if swallowed, in contact with skin or if inhaled [Warning Acute toxicity, oralacute toxicity, dermalacute toxicity, inhalation]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 4 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (50%) |
| 관세 코드 | 2922290090 |
| 위험 문구(R) | 22 |
| 위험 표시 | Xi,Xn |
| 위험 참고 사항 | Irritant |