Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
HCID 459713생성일: 2026년 11월 1일
8-Acetamido-5-amino-6-(methylthio)quinoline
8-Acetamido-5-amino-6-(methylthio)quinoline · Acetamide, N-[5-amino-6-(methylthio)-8-quinolinyl]-
https://huagongshe.com/ko/chemical/459713
식별자 및 물리적 특성
| CAS No. | 134992-40-8 |
|---|
| 분자식 | C12H13N3OS |
|---|
| 평균 분자량 | 247.32 g/mol |
|---|
| 단동위원소 질량 | 247.07793322 g/mol |
|---|
| SMILES | CSc1cc(NC(C)=O)c2ncccc2c1N |
|---|
| InChIKey | KSICPQPXAOXQCU-UHFFFAOYSA-N |
|---|
| PubChem CID | 459713 |
|---|
| EC No. | 660-788-2 |
|---|
| DTXSID | DTXSID20332693 |
|---|
화학 및 물리적 성질
| XLogP | 1.2 |
|---|
| 극성 표면적 | 93.3 |
|---|
| 수소 결합 공여자 수 | 2 |
|---|
| 수소 결합 수용자 수 | 4 |
|---|
| 회전 가능 결합 수 | 2 |
|---|
| 무거운 원자 수 | 17 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 287 |
|---|
| 녹는점 | 141-143 °C |
|---|
| 끓는 점 | 406.4±45.0 °C(Predicted) |
|---|
| 밀도 | 1.31±0.1 g/cm3(Predicted) |
|---|
| pKa(산도 계수) | 15.10±0.43(Predicted) |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P317, P305+P351+P338, P330, P337+P317, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| 신호 어 | Warning |
|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
|---|
