Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
살로인트L130796-1EA
살로인트L130796-1EA · SALOR-INT L130796-1EA · 3-(2-Acetoxy-4,6-dimethylphenyl)-3-methylbutyric acid · 3-(2-Acetoxy-4,6-dimethylphenyl)-3-methylbutyric acid 97% · Benzenepropanoic acid, 2-(acetyloxy)-β,β,4,6-tetramethyl- · 3-(2'-acetoxy-4',6'-dimethylphenyl)-3,3-dimethylpropanoic acid
식별자 및 물리적 특성
| CAS No. | 134098-68-3 |
|---|---|
| 분자식 | C15H20O4 |
| 평균 분자량 | 264.32 g/mol |
| 단동위원소 질량 | 264.13615911 g/mol |
| SMILES | CC(=O)Oc1cc(C)cc(C)c1C(C)(C)CC(=O)O |
| InChIKey | IRUYOPOSEOEWIN-UHFFFAOYSA-N |
| PubChem CID | 4645809 |
| EC No. | 694-482-5 |
| 현지명 | 살로인트L130796-1EA |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 63.6 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 348 |
| 녹는점 | 113-118°C |
| 저장 조건 | 2-8°C |
| 물리적 상태 | solid |
안전 및 규제
| GHS 분류 | DangerH301 (97.5%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P316, P305+P351+P338, P321, P330, P337+P317, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (97.5%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2811 6.1 / PGIII |
| 위험 문구(R) | 25-36 |
| 위험 표시 | T |
| 안전 문구(S) | 26-45 |
용도
용도
Used as a trimethyl lock in stable chromogenic substrates for esterases