Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
p-초산니트로벤젠
p-초산니트로벤젠 · 2-(4-NITROPHENYL)ACETIC ACID · 4-NITRO-A-TOLUIC ACID · 4-NITROBENZENEACETIC ACID · paraNitro Phenyl Acetic Acid · 4-Nitrophenylacetic · RARECHEM AL BO 0237 · -Nitro-a-toluic acid
식별자 및 물리적 특성
| CAS No. | 104-03-0 |
|---|---|
| 분자식 | C8H7NO4 |
| 평균 분자량 | 181.15 g/mol |
| 단동위원소 질량 | 181.0375077 g/mol |
| SMILES | O=C(O)Cc1ccc([N+](=O)[O-])cc1 |
| InChIKey | YBADLXQNJCMBKR-UHFFFAOYSA-N |
| PubChem CID | 4661 |
| ChEBI | CHEBI:40443 |
| EC No. | 203-168-5 |
| DTXSID | DTXSID6059289 |
| 현지명 | p-초산니트로벤젠 |
화학 및 물리적 성질
| XLogP | 1.4 |
|---|---|
| 극성 표면적 | 83.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 203 |
| 물질 분류 | Nitrogen Compounds -> Other Aromatics (Nitrogen) |
| 의약품 | Pharmaceuticals -> Listed in ZINC15 |
| SpringerMaterials Properties | Chemical shift |
| LogP(분배 계수) | 1.54 |
| 증기압 | 0.0000291 [mmHg] |
| Physical Description | Pale yellow solid[Merck Index] Yellow powder[Alfa Aesar MSDS] |
| 녹는점 | 150-155 °C(lit.) |
| 끓는 점 | 314.24°C (rough estimate) |
| 밀도 | 1.4283 (rough estimate) |
| 굴절률 | 1.5468 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 결정성 분말 |
| pKa(산도 계수) | 3.85(at 25℃) |
| 색상 | 베이지색에서 노란색까지 |
| pH | 2.98 at 22.8℃ and 10g/L |
| 용해도 | 약간 용해됨 |
| Merck | 14,6621 |
| BRN | 1911801 |
| InChI | 1S/C8H7NO4/c10-8(11)5-6-1-3-7(4-2-6)9(12)13/h1-4H,5H2,(H,10,11) |
| InChIKey | YBADLXQNJCMBKR-UHFFFAOYSA-N |
| SMILES | OC(=O)Cc1ccc(cc1)[N+]([O-])=O |
| LogP(분배 계수) | 0.3 at 30℃ and pH7.72 |
| EPA | 4-Nitrophenylacetic acid (104-03-0) |
화학적 성질
Beige to yellow crystalline powder4-Nitrophenylacetic acid is a member of the class of phenylacetic acids that is phenylacetic acid in which the phenyl grup is substituted at the para- position by a nitro group.
안전 및 규제
| GHS 분류 | WarningH315 (93.3%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 90 reports by companies from 10 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 18-11-2020 https://echa.europa.eu/registration-dossier/-/registered-dossier/16775Benzeneacetic acid, 4-nitro-: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | A skin and strong eye irritant[Alfa Aesar MSDS] See Nitrobenzene and Phenylacetic acid. |
| Hazard Classes and Categories | Skin Irrit. 2 (93.3%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | AJ1130010 |
| 운송 번호(UN) | UN 3077 9 / PGIII |
| 독성 | dnr-bcs 500 mg/disc MUREAV170,11,86 |
| 관세 코드 | 29163900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37/39 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Aquatic Acute 1Aquatic Chronic 1Eye Dam. 1 |
| 저장 분류 | 13 - Non Combustible Solids |
용도
용도
Intermediate for dyestuffs, pharmaceuticals, penicillin precursors, local anesthetics.