Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
(2R,3R)-5,7-dihydroxy-2-{3,4,6-trihydroxy-5-oxo-8-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-2-yl]-5H-benzo[7]annulen-1-yl}-3,4-dihydro-2H-1-benzopyran-3-yl 3,4,5-trihydroxybenzoate
TF-3'-G · Theaflavin-3’-gallate · Theaflavin 2B · THEAFLAVINMONOGALLATEB · Theaflavin-3''-Gallate · THEAFLAVIN 3'-O-GALLATE · 3'-O-(3,4,5-Trihydroxybenzoyl) · Theaflavin-3'-Gallate (TF-3'-G)
![(2R,3R)-5,7-dihydroxy-2-{3,4,6-trihydroxy-5-oxo-8-[(2R,3R)-3,5,7-trihydroxy-3,4-dihydro-2H-1-benzopyran-2-yl]-5H-benzo[7]annulen-1-yl}-3,4-dihydro-2H-1-benzopyran-3-yl 3,4,5-trihydroxybenzoate 분자 구조식](/img/chemical/467321.png)
식별자 및 물리적 특성
| CAS No. | 28543-07-9 |
|---|---|
| 분자식 | C36H28O16 |
| 평균 분자량 | 716.6 g/mol |
| 단동위원소 질량 | 716.1377348 g/mol |
| SMILES | O=C(O[C@@H]1Cc2c(O)cc(O)cc2O[C@@H]1c1cc(O)c(O)c2c(O)c(=O)cc([C@H]3Oc4cc(O)cc(O)c4C[C@H]3O)cc12)c1cc(O)c(O)c(O)c1 |
| InChIKey | GPLOTACQBREROW-WQLSNUALSA-N |
| PubChem CID | 467321 |
| ChEMBL | CHEMBL423795 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 284 |
| 수소 결합 공여자 수 | 11 |
| 수소 결합 수용자 수 | 16 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 52 |
| 형식 전하 | 0 |
| 복잡도 | 1,600 |
| 끓는 점 | 1226.9±65.0 °C(Predicted) |
| 밀도 | 1.93 |
| 저장 조건 | -20°C |
| 용해도 | Soluble in ethanol and methan |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 6.55±0.20(Predicted) |
| 색상 | 오렌지 브라운 |
| 주요 응용 | 음식 및 음료 |
| InChIKey | GPLOTACQBREROW-WQLSNUALSA-N |
| SMILES | C(O[C@@H]1CC2=C(O)C=C(O)C=C2O[C@@H]1C1=C2C=C([C@H]3OC4=CC(O)=CC(O)=C4C[C@H]3O)C=C(O)C(=O)C2=C(O)C(O)=C1)(=O)C1=CC(O)=C(O)C(O)=C1 |
안전 및 규제
| 수질 위해 등급(WGK) | WGK 3 |
|---|---|
| 관세 코드 | 29182900 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Theaflavin-3''-O-gallate is a theaflavin found in black tea that has shown to induce apoptosis through promoting mitochondrial dysfunction in human prostate cancer cells.