팔로이딘
팔로이딘 · Nsc523214 · PHALLOIDIN · phalloidine · Glycerol Formal Impurity 5 · Phalloidin *CAS#: 17466-45-4* · PHALLOIDIN, AMANITA PHALLOIDES · Phalloidin trifluoroacetate salt
식별자 및 물리적 특성
| CAS No. | 17466-45-4 |
|---|---|
| 분자식 | C35H48N8O11S |
| 평균 분자량 | 788.9 g/mol |
| 단동위원소 질량 | 788.31632536 g/mol |
| SMILES | CC1NC(=O)C(CC(C)(O)CO)NC(=O)C2Cc3c([nH]c4ccccc34)SCC(NC(=O)C(C(C)O)NC1=O)C(=O)N1CC(O)CC1C(=O)NC(C)C(=O)N2 |
| InChIKey | KPKZJLCSROULON-UHFFFAOYSA-N |
| PubChem CID | 4752 |
| DTXSID | DTXSID3037254 |
| 현지명 | 팔로이딘 |
화학 및 물리적 성질
| XLogP | -1.7 |
|---|---|
| 극성 표면적 | 317 |
| 수소 결합 공여자 수 | 11 |
| 수소 결합 수용자 수 | 12 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 55 |
| 형식 전하 | 0 |
| 복잡도 | 1,510 |
| 녹는점 | 280-282° |
| 밀도 | 1.1612 (rough estimate) |
| 굴절률 | 1.7400 (estimate) |
| 저장 조건 | +2C to +8C |
| 용해도 | DMF: 10 mg/mlDMSO: 10 mg/mlEthanol: 10 mg/mlWater: 0.5 mg/ml (warm) |
| 물리적 상태 | 백색 결정성 고체 |
| 끓는 점 | 1370.5±65.0 °C(Predicted) |
| pKa(산도 계수) | 13.03±0.70(Predicted) |
| 색상 | 물에서 나온 육수화물, 바늘 또는 결정 |
| 생물학적 소스 | Amanita phalloides |
| 용해도 | Soluble to 1 mg/ml in water |
| Merck | 13,7273 |
| BRN | 4347460 |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| InChIKey | KPKZJLCSROULON-UHFFFAOYSA-N |
| SMILES | CC(O)C1NC(=O)C(C)NC(=O)C(CC(C)(O)CO)NC(=O)C2Cc3c(SCC(NC1=O)C(=O)N4CC(O)CC4C(=O)NC(C)C(=O)N2)[nH]c5ccccc35 |
화학적 성질
white powder
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| RTECS 번호 | SE9800000 |
| 운송 번호(UN) | UN 3462 6.1/PG 2 |
| 독성 | LD50 i.m. in albino mice: 3.3 mg/g (Vogt)LD50 i.p. in mice: 2 mg/kg (Wieland, Wieland) |
| 관세 코드 | 2934999090 |
| 위험 문구(R) | 26/27/28 |
| 위험 표시 | T+ |
| 안전 문구(S) | 22-28-36/37-45 |
| 포장분류 | I |
| 위험 등급 | 6.1(a)Acute Tox. 2 Oral |
| F 고인화성물질 | 18 |
| 저장 분류 | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
| 유해 물질 데이터 | 17466-45-4(Hazardous Substances Data) |
용도
개요
Phalloidin is a natural mycotoxin first isolated from the death cap mushroom, A. phalloides. It binds F-actin and stabilizes actin fibers. Fluorescently labeled phalloidin is commonly used to stain F-actin in cells.
용도
Phalloidin has been used: As a supplement in PEM buffer and dimethyl sulfoxide (DMSO).As a drug.In immunohistochemistry to stain F-actin.
일반 설명
Phalloidin is a phallotoxin produced by death cap mushroom Amanita phalloides. It is a cyclic peptide, which interacts with actin, and this was first identified in phalloidin-poisoned rats. It is a heptapeptide, cyclic in nature, with a crosslink between tryptophan at position 6 and cysteine at position 3. The side chain of amino acid 7 (γ-δ-dihydroxyleucine) in phalloidin, is accessible to modifications, through which fluorescently labeled phalloidin compounds can be produced.