식별자 및 물리적 특성
| CAS No. | 118428-37-8 |
|---|
| 분자식 | C19H18N4O2 |
|---|
| 평균 분자량 | 334.4 g/mol |
|---|
| 단동위원소 질량 | 334.14297582 g/mol |
|---|
| SMILES | COc1ccc(-c2nc3ccc(C4=NNC(=O)CC4C)cc3[nH]2)cc1 |
|---|
| InChIKey | GLBJJMFZWDBELO-UHFFFAOYSA-N |
|---|
| PubChem CID | 4823 |
|---|
| ChEMBL | CHEMBL24646 |
|---|
| ChEBI | CHEBI:32003 |
|---|
| EC No. | 640-420-7 |
|---|
| DTXSID | DTXSID8048280 |
|---|
| 현지명 | l-피모벤단 |
|---|
화학 및 물리적 성질
| XLogP | 2.7 |
|---|
| 극성 표면적 | 79.4 |
|---|
| 수소 결합 공여자 수 | 2 |
|---|
| 수소 결합 수용자 수 | 4 |
|---|
| 회전 가능 결합 수 | 3 |
|---|
| 무거운 원자 수 | 25 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 530 |
|---|
| Animal Drugs | FDA approved animal drugs -> Active ingredientPharmaceuticals -> UK Veterinary Medicines Directorate List |
|---|
| 끓는 점 | 471.18°C (rough estimate) |
|---|
| 밀도 | 1.2421 (rough estimate) |
|---|
| 굴절률 | 1.6620 (estimate) |
|---|
| pKa(산도 계수) | 10.21±0.10(Predicted) |
|---|
안전 및 규제
| GHS 분류 | DangerH301 (20%): Toxic if swallowed [Danger Acute toxicity, oral]P203, P261, P264, P270, P271, P273, P280, P301+P316, P301+P317, P304+P340, P317, P318, P321, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 10 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| 규제 정보 | Pimobendan: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
|---|
| Hazard Classes and Categories | Acute Tox. 3 (20%) |
|---|
