식별자 및 물리적 특성
| CAS No. | 82-98-4 |
|---|
| 분자식 | C21H25NO2 |
|---|
| 평균 분자량 | 323.4 g/mol |
|---|
| 단동위원소 질량 | 323.18852904 g/mol |
|---|
| SMILES | CCN1CCCC(OC(=O)C(c2ccccc2)c2ccccc2)C1 |
|---|
| InChIKey | KTHVBAZBLKXIHZ-UHFFFAOYSA-N |
|---|
| PubChem CID | 4839 |
|---|
| ChEMBL | CHEMBL1623992 |
|---|
| ChEBI | CHEBI:91986 |
|---|
| EC No. | 201-449-7 |
|---|
| DTXSID | DTXSID7048164 |
|---|
| 현지명 | 피페리돌레이트 |
|---|
화학 및 물리적 성질
| XLogP | 4.4 |
|---|
| 극성 표면적 | 29.5 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 3 |
|---|
| 회전 가능 결합 수 | 6 |
|---|
| 무거운 원자 수 | 24 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 367 |
|---|
| Human Drugs | Pharmaceuticals |
|---|
| Collision Cross Section | 178.33 Ų [M+H]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards] |
|---|
| 녹는점 | <25 °C |
|---|
| 끓는 점 | bp0.18 191-192° |
|---|
| 밀도 | 1.11±0.1 g/cm3(Predicted) |
|---|
| 저장 조건 | Store at -20°C |
|---|
| 용해도 | DMSO : ≥ 150 mg/mL (463.78 mM) |
|---|
| pKa(산도 계수) | 7.97±0.10(Predicted) |
|---|
| 물리적 상태 | Liquid |
|---|
| 색상 | Colorless to light yellow |
|---|
안전 및 규제
| GHS 분류 | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P261, P262, P264, P270, P271, P280, P301+P316, P302+P352, P304+P340, P316, P321, P330, P361+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
|---|
| 독성 | LD50 intravenous in guinea pig: 16mg/kg |
|---|
| 위험 문구(R) | 23/24/25 |
|---|
| 위험 표시 | T |
|---|
| 안전 문구(S) | 36/37/39-45 |
|---|
