Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5-알릴-5-부틸바르비투르산
5-알릴-5-부틸바르비투르산 · Einecs 221-562-5 · Butalbital Impurity 3 · n-Butylallylbarbitone · Butalbital Impurity G · Allyl-butyl-barbitursaeure · n-Butylallylbarbituric acid · 5-allyl-5-butylbarbituric acid
식별자 및 물리적 특성
| CAS No. | 3146-66-5 |
|---|---|
| 분자식 | C11H16N2O3 |
| 평균 분자량 | 224.26 g/mol |
| 단동위원소 질량 | 224.11609238 g/mol |
| SMILES | C=CCC1(CCCC)C(=O)NC(=O)NC1=O |
| InChIKey | RRWVWLGUQPLOMY-UHFFFAOYSA-N |
| PubChem CID | 48522 |
| ChEMBL | CHEMBL467779 |
| EC No. | 221-562-5 |
| DTXSID | DTXSID90185370 |
| 현지명 | 5-알릴-5-부틸바르비투르산 |
화학 및 물리적 성질
| XLogP | 2 |
|---|---|
| 극성 표면적 | 75.3 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 316 |
| 녹는점 | 110 °C |
| 끓는 점 | 365.66°C (rough estimate) |
| 밀도 | 1.1672 (rough estimate) |
| 굴절률 | 1.4720 (estimate) |
| pKa(산도 계수) | 7.80±0.10(Predicted) |
| 용해도 | 1.508g/L(20℃) |
안전 및 규제
| 기타 안전 정보 | IMAP assessments - 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-butyl-5-(2-propenyl)-: Environment tier I assessment |
|---|
용도
용도
Idobutal is used in the biotransformation of drugs, quantitative structure-activity relations, substance for the determination of barbiturates in the urine by using enzyme immunoassay and radio immunoassay, estimation of the solubility of drug like-organic compounds-case study in barbiturates.