살리신
살리신 · SALICIN · D-SALICIN · Salicine · SALICOSIDE · WHITE WILLOW · Salicylin · Salicin-RM
식별자 및 물리적 특성
| CAS No. | 138-52-3 |
|---|---|
| 분자식 | C13H18O7 |
| 평균 분자량 | 286.28 g/mol |
| 단동위원소 질량 | 286.10525291 g/mol |
| SMILES | OCc1ccccc1OC1OC(CO)C(O)C(O)C1O |
| InChIKey | NGFMICBWJRZIBI-UHFFFAOYSA-N |
| PubChem CID | 5145 |
| ChEMBL | CHEMBL315895 |
| 현지명 | 살리신 |
화학 및 물리적 성질
| XLogP | -1.2 |
|---|---|
| 극성 표면적 | 120 |
| 수소 결합 공여자 수 | 5 |
| 수소 결합 수용자 수 | 7 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 20 |
| 형식 전하 | 0 |
| 복잡도 | 300 |
| 녹는점 | 196-202 °C |
| 끓는 점 | 388.65°C (rough estimate) |
| 밀도 | 1.4340 |
| 굴절률 | -62 ° (C=3, H2O) |
| 저장 조건 | 2-8°C |
| 용해도 | 36g/L |
| 물리적 상태 | 미세 결정성 분말 |
| pKa(산도 계수) | 12.80±0.70(Predicted) |
| 색상 | 하얀색 |
| 용해도 | 36g/L(15℃), 250g/L(60℃) |
| Merck | 14,8324 |
| BRN | 89593 |
| 안정성 | 안정적이지만 빛에 민감합니다. 강한 산화제와 호환되지 않습니다. |
| 주요 응용 | 청소용품화장품향료 및 향음식 및 음료개인 위생 관리 |
| 화장품 원료 기능 | 피부 컨디셔닝 |
| InChI | 1S/C13H18O7/c14-5-7-3-1-2-4-8(7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-4,9-18H,5-6H2/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | NGFMICBWJRZIBI-MICYEWLZSA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2ccccc2CO)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP(분배 계수) | -1.232 (est) |
| NIST | Salicin(138-52-3) |
| EPA | .beta.-D-Glucopyranoside, 2-(hydroxymethyl)phenyl (138-52-3) |
화학적 성질
white crystals or powder
안전 및 규제
| 규제 정보 | .beta.-D-Glucopyranoside, 2-(hydroxymethyl)phenyl: Does not have an individual approval but may be used under an appropriate group standard |
|---|---|
| 기타 안전 정보 | IMAP assessments - .beta.-D-Glucopyranoside, 2-(hydroxymethyl)phenyl: Environment tier I assessment |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | LZ5901700 |
| 관세 코드 | 29389090 |
| 위험 문구(R) | 43 |
| 위험 표시 | Xi |
| 안전 문구(S) | 36/37-37-24/25-36 |
| F 고인화성물질 | 3-10 |
| 위험 등급 | Skin Sens. 1 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
D-(-)-Salicin has been used:to study its in vitro anticoagulant and antiplatelet activitiesas a standard in high performance liquid chromatography method (HPLC) for quantitation of salicin from willow plantas a tastant in taste threshold assayas a constituent of nutrient agar-salicin medium for selective isolation of Lactobacillus paracasei
일반 설명
Salicin is a non-phenolic glucosidic compound extracted from meadowsweet (Filipendula ulmaria L). It is majorly used as a substitute for quinine. Salicin can be used as a therapeutic for patients suffering from rheumatic fever. Salicin acts a metabolic precursor for salicylic acid. It is a novel phytochemical that exhibits immunological cross functions in plants and humans. Salicin facilitates growth and reproduction in plants. In addition, It also protects plants against biotic and abiotic stress.