Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
(2-나프틸옥시)트리메틸실란
(2-나프틸옥시)트리메틸실란 · Trimethyl(2-naphtyloxy)silane · (2-Naphtyloxy)trimethylsilane · 2-(Trimethylsiloxy)naphthalene · 2-(Trimethylsilyloxy)naphthalene · (2-Naphtyl)(trimethylsilyl) ether · Trimethyl(2-naphthalenyloxy)silane · Naphthalene, 2-[(trimethylsilyl)oxy]-
식별자 및 물리적 특성
| CAS No. | 18081-08-8 |
|---|---|
| 분자식 | C13H16OSi |
| 평균 분자량 | 216.35 g/mol |
| 단동위원소 질량 | 216.09704166 g/mol |
| SMILES | C[Si](C)(C)Oc1ccc2ccccc2c1 |
| InChIKey | HJWDNWKQENUSKL-UHFFFAOYSA-N |
| PubChem CID | 519513 |
| DTXSID | DTXSID50334049 |
| 현지명 | (2-나프틸옥시)트리메틸실란 |
화학 및 물리적 성질
| 극성 표면적 | 9.2 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 209 |
| 녹는점 | 69-72 °C |
| 끓는 점 | 98.2-101.0 °C(Press: 8 Torr) |
| 밀도 | 1.000±0.06 g/cm3(Predicted) |
용도
용도
2-[(Trimethylsilyl)oxy]naphthalene is an intermediate in the synthesis of 2-Sulfamate-2-deoxy-1-α-(2-naphthyl)-glucopyranoside Sodium Salt (S789204), a derivative of Napthalene (N345600), an abundant polycyclic aromatic hydrocarbon that is persistent, bioaccumulative, toxic and found in tobacco smoke and urban air.