Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
메틸-5-아미노-2-클로로벤조에이트
메틸-5-아미노-2-클로로벤조에이트 · TIMTEC-BB SBB013130 · OTAVA-BB 7020693933 · METHYL 2-CHLORO-5-AMINOBENZOATE · Methyl 3-amino-6-chlorobenzoate · Methyl-5-amino-2-chlorobenzoate · Methyl 2-chloro-5-aminobenzoate 95+% · 5-Amino-2-chlorobenzoic acid methyl ester
식별자 및 물리적 특성
| CAS No. | 42122-75-8 |
|---|---|
| 분자식 | C8H8ClNO2 |
| 평균 분자량 | 185.61 g/mol |
| 단동위원소 질량 | 185.02435618 g/mol |
| SMILES | COC(=O)c1cc(N)ccc1Cl |
| InChIKey | LBNPBOFVHYOPIB-UHFFFAOYSA-N |
| PubChem CID | 5200412 |
| EC No. | 834-831-2 |
| DTXSID | DTXSID40409457 |
| 현지명 | 메틸-5-아미노-2-클로로벤조에이트 |
화학 및 물리적 성질
| XLogP | 2.7 |
|---|---|
| 극성 표면적 | 52.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 174 |
| 녹는점 | 68-70℃ |
| 끓는 점 | 320℃ |
| 밀도 | 1.311 |
| 인화점 | 147℃ |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2–8 °C |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | powder to lump |
| pKa(산도 계수) | 2.81±0.10(Predicted) |
| 색상 | 흰색에서 노란색, 주황색으로 |
| InChI | InChI=1S/C8H8ClNO2/c1-12-8(11)6-4-5(10)2-3-7(6)9/h2-4H,10H2,1H3 |
| InChIKey | LBNPBOFVHYOPIB-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC(N)=CC=C1Cl |
화학적 성질
Pale yellow crystal
안전 및 규제
| GHS 분류 | WarningH302 (66.7%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (66.7%) |
| 관세 코드 | 2916399090 |
용도
용도
Methyl 5-amino-2-chlorobenzoate