Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,5-Bis(trifluoromethyl)benzenesulphonyl chloride
BIS(TRIFLUOROMETHYL)BENZENESULFONYL CHLORIDE · 3,5-BI · BUTTPARK 145\11-95 · 3,5-BIS(TRIFLUOROMETHYL)BENZENESULFONYL · 3,5-bis(trimethyl)benzenesulfonyl chloride · 3,5-BS(TRIFLUOROMETHYL)BENZENESULFONYL CHLOR · 3,5-Di(trifluoromethyl)benzene sulfonyl chloride · 3,5-Bis(trifluoromethyl)benzenesulfonyl chloride
식별자 및 물리적 특성
| CAS No. | 39234-86-1 |
|---|---|
| 분자식 | C8H3ClF6O2S |
| 평균 분자량 | 312.62 g/mol |
| 단동위원소 질량 | 311.94464734 g/mol |
| SMILES | O=S(=O)(Cl)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChIKey | BTRCVKADYDVSLI-UHFFFAOYSA-N |
| PubChem CID | 520945 |
| EC No. | 254-371-0 |
| DTXSID | DTXSID00192494 |
화학 및 물리적 성질
| XLogP | 4.3 |
|---|---|
| 극성 표면적 | 42.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 8 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 373 |
| 녹는점 | 34-38 °C(lit.) |
| 끓는 점 | 70°C 2mm |
| 밀도 | 1.618±0.06 g/cm3(Predicted) |
| 인화점 | 228 °F |
| 저장 조건 | Inert atmosphere,2-8°C |
| 용해도 | 톨루엔에 용해됨 |
| 물리적 상태 | powder to lump |
| 색상 | White to Orange to Green |
| BRN | 3621218 |
| InChI | InChI=1S/C8H3ClF6O2S/c9-18(16,17)6-2-4(7(10,11)12)1-5(3-6)8(13,14)15/h1-3H |
| InChIKey | BTRCVKADYDVSLI-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 |
| NIST | 3,5-Bis(trifluoromethyl)benzenesulfonyl chloride(39234-86-1) |
화학적 성질
White to Yellow crystal or powder
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 50 reports by companies from 4 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 3261 8/PG 2 |
| 관세 코드 | 29049090 |
| 위험 문구(R) | 34 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36-36/37/39-45 |
| 포장분류 | III |
| 위험 등급 | 8Skin Corr. 1B |
| 위험 참고 사항 | Corrosive/Hygroscopic |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |