Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
스파이페론
스파이페론 · Spiropitan · r5147 · Spiperon · SPIPERONE · Luopenglong · SPIROPERIDOL · Spiperone-d5
식별자 및 물리적 특성
| CAS No. | 749-02-0 |
|---|---|
| 분자식 | C23H26FN3O2 |
| 평균 분자량 | 395.5 g/mol |
| 단동위원소 질량 | 395.20090529 g/mol |
| SMILES | O=C(CCCN1CCC2(CC1)C(=O)NCN2c1ccccc1)c1ccc(F)cc1 |
| InChIKey | DKGZKTPJOSAWFA-UHFFFAOYSA-N |
| PubChem CID | 5265 |
| ChEMBL | CHEMBL267930 |
| ChEBI | CHEBI:9233 |
| EC No. | 212-024-0 |
| DTXSID | DTXSID5045205 |
| 현지명 | 스파이페론 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 52.7 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 6 |
| 무거운 원자 수 | 29 |
| 형식 전하 | 0 |
| 복잡도 | 577 |
| 용해도 | 50.1 [ug/mL] (The mean of the results at pH 7.4)H2O: 난용성0.2mg/mL |
| Collision Cross Section | 193.8 Ų [M+H]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards]199.03 Ų [M+Na]+ [CCS Type: TW |
| 녹는점 | 190-193.60C |
| 끓는 점 | 630.6±55.0 °C(Predicted) |
| 밀도 | 1.1714 (estimate) |
| 저장 조건 | Store at RT |
| pKa(산도 계수) | pKa 8.31 (Uncertain)9.09 (Uncertain) |
| 물리적 상태 | 고체 |
| 색상 | 연노랑 |
| 용해도 | 32mg/L(22 ºC) |
| InChI | 1S/C23H26FN3O2/c24-19-10-8-18(9-11-19)21(28)7-4-14-26-15-12-23(13-16-26)22(29)25-17-27(23)20-5-2-1-3-6-20/h1-3,5-6,8-11H,4,7,12-17H2,(H,25,29) |
| InChIKey | DKGZKTPJOSAWFA-UHFFFAOYSA-N |
| SMILES | Fc1ccc(cc1)C(=O)CCCN2CCC3(CC2)N(CNC3=O)c4ccccc4 |
화학적 성질
Off-White Solid
안전 및 규제
| GHS 분류 | WarningH302 (98.5%): Harmful if swallowed [Warning Acute toxicity, oral]P203, P264, P270, P280, P301+P317, P318, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 68 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (98.5%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | XX8925000 |
| 위험 문구(R) | 22-63 |
| 위험 표시 | Xn |
| 안전 문구(S) | 36/37 |
| 위험 등급 | Acute Tox. 4 OralRepr. 2 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Spiperone is an antipsychotic.
일반 설명
Spiperone is a butyrophenone antipsychotic agent. It induces calcium-dependent chloride secretion in the airway and functions as a potential therapeutic target for cystic fibrosis.