Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Methyl 1,8-diethyl-1,3,4,9-tetrahydropyrano(3,4-b)indole-1-acetate
Methyl etodolac · Etodolac impurity K · Etodolac Impurity 11 · Etodolac methyl ester · Etodolac EP Impurity K · EtodolacMethylEster99% · Etodolacmethylester(ETM) · Etoronic acid EP impurity K
식별자 및 물리적 특성
| CAS No. | 122188-02-7 |
|---|---|
| 분자식 | C18H23NO3 |
| 평균 분자량 | 301.4 g/mol |
| 단동위원소 질량 | 301.1677936 g/mol |
| SMILES | CCc1cccc2c3c([nH]c12)C(CC)(CC(=O)OC)OCC3 |
| InChIKey | CRRWJZHQYUTACF-UHFFFAOYSA-N |
| PubChem CID | 527310 |
| EC No. | 601-924-2 |
| DTXSID | DTXSID60881392 |
화학 및 물리적 성질
| XLogP | 3.1 |
|---|---|
| 극성 표면적 | 51.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 22 |
| 형식 전하 | 0 |
| 복잡도 | 413 |
| 끓는 점 | 447.4±40.0 °C(Predicted) |
| 밀도 | 1.132±0.06 g/cm3(Predicted) |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 16.82±0.40(Predicted) |
| 색상 | 흰색에서 황백색까지 |
| InChI | InChI=1S/C18H23NO3/c1-4-12-7-6-8-13-14-9-10-22-18(5-2,11-15(20)21-3)17(14)19-16(12)13/h6-8,19H,4-5,9-11H2,1-3H3 |
| InChIKey | CRRWJZHQYUTACF-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2CC)C2CCOC(CC)(CC(OC)=O)C1=2 |
화학적 성질
White Solid
안전 및 규제
| GHS 분류 | DangerH301 (100%): Toxic if swallowed [Danger Acute toxicity, oral]P203, P261, P262, P264, P270, P271, P280, P301+P316, P302+P352, P304+P340, P316, P318, P321, P330, P361+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 8 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 31-05-2018 https://echa.europa.eu/registration-dossier/-/registered-dossier/21948 |
| Hazard Classes and Categories | Acute Tox. 3 (100%) |
| 신호 어 | Danger |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H301 |
용도
용도
Etodolac derivative