Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
메틸 리놀레산
루티다인(2,3-) · 메틸리놀레산염 · 메틸일노르산 · 메틸리놀레산 · 메틸리놀리에이트 · 메틸 리놀레산 · 메틸시스,시스-9,12-옥타데카디에노에이트 · LINOLEIC ACID METHYL ESTER
식별자 및 물리적 특성
| CAS No. | 112-63-0 |
|---|---|
| 분자식 | C19H34O2 |
| 평균 분자량 | 294.5 g/mol |
| 단동위원소 질량 | 294.25588033 g/mol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC |
| InChIKey | WTTJVINHCBCLGX-NQLNTKRDSA-N |
| PubChem CID | 5284421 |
| ChEMBL | CHEMBL3183866 |
| ChEBI | CHEBI:69080 |
| EC No. | 203-993-0 |
| DTXSID | DTXSID7020843 |
| 현지명 | 메틸 리놀레산 |
화학 및 물리적 성질
| XLogP | 6.9 |
|---|---|
| 극성 표면적 | 26.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 15 |
| 무거운 원자 수 | 21 |
| 형식 전하 | 0 |
| 복잡도 | 279 |
| 화장품 | EmollientSkin conditioning |
| SpringerMaterials Properties | Boiling point |
| 향료 | Fragrance Ingredient (Methyl linoleate) -> IFRA transparency List |
| LogP(분배 계수) | 6.82 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 끓는 점 | 373.00 to 374.00 °C. @ 760.00 mm Hg192 °C/4 mmHg (lit.) |
| 녹는점 | -35 °C-35 °C (lit.) |
| Physical Description | Liquid |
| Collision Cross Section | 183.18 Ų [M-H]- [CCS Type: DTMethod: stepped-field]186 Ų [M+H]+ |
| 밀도 | 0.889 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.462(lit.) |
| FEMA | 3411 | METHYL LINOLEATE (48%) METHYL LINOLENATE (52%) MIXTURE |
| 인화점 | 200°C |
| 저장 조건 | -20°C |
| 용해도 | DMF, 지방 용매, 오일에 용해됩니다. |
| 물리적 상태 | 액체 |
| 색상 | 무색 |
| 비중 | 0.88 |
| 냄새 | 100.00%에서. 기름진 지방 우디 |
| 향취 유형 | 기름진 냄새 |
| Merck | 14,6095 |
| JECFA Number | 346 |
| BRN | 1727614 |
| 헨리 상수 | 6.2×10-2 mol/(m3Pa) at 25℃, Krop and Velzen (1997) |
| 유전율 | 3.2000000000000002 |
| 안정성 | 감광성 |
| 화장품 원료 기능 | 피부 컨디셔닝 - 보습제향수피부 컨디셔닝 |
| InChI | 1S/C19H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h7-8,10-11H,3-6,9,12-18H2,1-2H3/b8-7-,11-10- |
| InChIKey | WTTJVINHCBCLGX-NQLNTKRDSA-N |
| SMILES | CCCCC\C=C/C\C=C/CCCCCCCC(=O)OC |
| LogP(분배 계수) | 7.64 |
| EPA | Methyl linoleate (112-63-0) |
화학적 성질
Clear pale to dark yellow liquid
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for > 99.9% (1563 of 1564) of all reports.Not ClassifiedAggregated GHS information provided per 1564 reports by companies from 2 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Chemical: 9,12-Octadecadienoic acid, (Z,Z)-, methyl esterMethyl linoleate: Does not have an individual approval but may be used under an appropriate group standard |
| 기타 안전 정보 | IMAP assessments - 9,12-Octadecadienoic acid, (Z,Z)-, methyl ester: Human health tier I assessment |
| Hazard Classes and Categories | Not Classified |
| Carcinogen Classification | No indication of carcinogenicity to humans (not listed by IARC). |
| 수질 위해 등급(WGK) | 1 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 1206 3/PG 2 |
| 관세 코드 | 29161500 |
| 위험 문구(R) | 11-38-50/53-65-67 |
| 위험 표시 | F,Xn,N |
| 안전 문구(S) | 23-24/25-62-61-60-33-29-16-9 |
| 기존화학 물질 | KE-26314 |
| F 고인화성물질 | 10-23 |
| 저장 분류 | 10 - Combustible liquids |
용도
출처
Reported found in banana, grape, grapefruit juice, melon, strawberries, mushroom and cassava.
용도
Methyl Linoleate is a common methyl ester produced from soybean or canola oil and methanol. Methyl Linoleate is classified as a biodiesel due to its long methyl ester chain and is used as a fuel in st andard diesel engines.
일반 설명
Methyl linoleate, non-conjugated, is more easily oxidized than conjugated methyl linoleate .