Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
에티스테론
에티스테론 · Progestoral · 17A-ETHYNYLTESTOSTERONE · Prone · Pranone · Pregnin · Gestoral · NSC-9565
식별자 및 물리적 특성
| CAS No. | 434-03-7 |
|---|---|
| 분자식 | C21H28O2 |
| 평균 분자량 | 312.4 g/mol |
| 단동위원소 질량 | 312.20893014 g/mol |
| SMILES | C#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChIKey | CHNXZKVNWQUJIB-CEGNMAFCSA-N |
| PubChem CID | 5284557 |
| ChEMBL | CHEMBL241694 |
| ChEBI | CHEBI:34749 |
| EC No. | 207-096-5 |
| DTXSID | DTXSID2023016 |
| 현지명 | 에티스테론 |
화학 및 물리적 성질
| XLogP | 3.5 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 23 |
| 형식 전하 | 0 |
| 복잡도 | 637 |
| SpringerMaterials Properties | Chemical shift |
| Human Drugs | Pharmaceuticals |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Collision Cross Section | 180.2 Ų [M+H]+ [CCS Type: DTBuffer gas: N2Ionization: APCI+Dataset: TOXCASTSource Identifier: DTXSID2023016] |
| 녹는점 | 263-269 °C (lit.) |
| 끓는 점 | 392.36°C (rough estimate) |
| 밀도 | 1.0697 (rough estimate) |
| 굴절률 | 33 ° (C=1, Pyridine) |
| 저장 조건 | room temp |
| 용해도 | Soluble to 0.05 mg/mL (0.16 mM) in DMSO |
| pKa(산도 계수) | 13.10±0.60(Predicted) |
| 물리적 상태 | Solid |
| 색상 | Light yellow to yellow |
| 생물학적 소스 | synthetic (organic) |
| 용해도 | 클로로포름, DMSO(0.05 mg/ml), 아세톤(약간 용해됨), 에탄올(25°C에서 <1 mg/ml) 및 물(25°C에서 <1 mg/ml)에 용해됩니다. |
| Merck | 14,3741 |
| BRN | 1889895 |
| InChI | 1S/C21H28O2/c1-4-21(23)12-9-18-16-6-5-14-13-15(22)7-10-19(14,2)17(16)8-11-20(18,21)3/h1,13,16-18,23H,5-12H2,2-3H3/t16-,17+,18+,19+,20+,21+/m1/s1 |
| InChIKey | CHNXZKVNWQUJIB-CEGNMAFCSA-N |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@@]4(C)[C@H]3CC[C@@]4(O)C#C |
| NIST | Ethisterone(434-03-7) |
화학적 성질
Off-White Powder
안전 및 규제
| GHS 분류 | DangerH360 (95.2%): May damage fertility or the unborn child [Danger Reproductive toxicity]P203, P280, P318, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 5 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Status: Active Update: 01-04-2022 https://echa.europa.eu/registration-dossier/-/registered-dossier/2184 |
| Hazard Classes and Categories | Repr. 1A (95.2%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | TU5570250 |
| 운송 번호(UN) | UN 2811 |
| 관세 코드 | 29372390 |
| 위험 문구(R) | 40-48-61 |
| 위험 표시 | Xn,T |
| 안전 문구(S) | 22-24/25-45-53 |
| 위험 등급 | Aquatic Acute 1Aquatic Chronic 1Repr. 1A |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
개요
Ethisterone is an orally bioavailable synthetic progestin and a derivative of testosterone (Item Nos. ISO60154 | 15645) that binds to progesterone and androgen receptors (EC50s = 23 and 23.1 nM, respectively, in yeast). Ethisterone (1 μM) downregulates progesterone receptors in MCF-7 cells.
용도
Ethisterone has been used as a component in Dulbecco′s modified eagle medium (DMEM) to culture the transfected COS-7 cell for transient transfection assay andgene transfection assay.
일반 설명
Ethisterone is aprogestogen. It is a danazol derivative.