Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
(1s,2s,4s)-P-Menthane-1,2,4-Triol
Mullilamdiol · 1,4-Epoxy-p-menthane-2,3-diol · 1-Methyl-4-(1-methylethyl)-7-oxabicyclo[2.2.1]heptane-2,3-diol · 1,2,4-Cyclohexanetriol, 1-methyl-4-(1-methylethyl)-, (1R,2R,4R)-rel- · Mullet (Mugilidae)redThis heading is used only when the specific taxonomycannot be established from the original documentMullilam diol
식별자 및 물리적 특성
| CAS No. | 36150-04-6 |
|---|---|
| 분자식 | C10H20O3 |
| 평균 분자량 | 188.267 g/mol |
| 단동위원소 질량 | 188.1412445 g/mol |
| SMILES | CC(C)[C@]1(O)CC[C@](C)(O)[C@@H](O)C1 |
| InChIKey | RKROZYQLIWCOBD-GUBZILKMSA-N |
| PubChem CID | 5326310 |
| ChEBI | CHEBI:207978 |
| DTXSID | DTXSID401356042 |
화학 및 물리적 성질
| 녹는점 | 171-172 °C |
|---|---|
| 끓는 점 | 282.8±40.0 °C(Predicted) |
| 밀도 | 1.131±0.06 g/cm3(Predicted) |
| pKa(산도 계수) | 14.50±0.60(Predicted) |