설파메타진
설파메타진 · SULFADIMIDINE · Sulphadimidine · SM2 · Sulphamethazine · sulfametazina · SULFADIMIDIN · SULFAMETAZINE
식별자 및 물리적 특성
| CAS No. | 57-68-1 |
|---|---|
| 분자식 | C12H14N4O2S |
| 평균 분자량 | 278.33 g/mol |
| 단동위원소 질량 | 278.08374688 g/mol |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(N)cc2)n1 |
| InChIKey | ASWVTGNCAZCNNR-UHFFFAOYSA-N |
| PubChem CID | 5327 |
| ChEMBL | CHEMBL446 |
| ChEBI | CHEBI:102265 |
| EC No. | 200-346-4 |
| DTXSID | DTXSID6021290 |
| 현지명 | 설파메타진 |
화학 및 물리적 성질
| XLogP | 0.3 |
|---|---|
| 극성 표면적 | 106 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 19 |
| 형식 전하 | 0 |
| 복잡도 | 377 |
| 녹는점 | 197 °C |
| 끓는 점 | 294°C (rough estimate) |
| 밀도 | 1.2997 (rough estimate) |
| 굴절률 | 1.6440 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | 아세톤: 가용성50mg/mL |
| 물리적 상태 | 결정성 분말 |
| pKa(산도 계수) | 7.4, 2.65(at 25℃) |
| 색상 | 흰색에서 황백색까지 |
| 용해도 | 150mg/100mL(29ºC) |
| Merck | 14,8905 |
| BRN | 261304 |
| 헨리 상수 | 3.2×107 mol/(m3Pa) at 25℃, HSDB (2015) |
| 안정성 | 안정적이지만 빛에 민감합니다. 강한 산화제와 호환되지 않습니다. |
| InChI | 1S/C12H14N4O2S/c1-8-7-9(2)15-12(14-8)16-19(17,18)11-5-3-10(13)4-6-11/h3-7H,13H2,1-2H3,(H,14,15,16) |
| InChIKey | ASWVTGNCAZCNNR-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(N)cc2)n1 |
| NIST | Sulfamethazine(57-68-1) |
| EPA | Sulfamethazine (57-68-1) |
화학적 성질
White to Off-Solid
안전 및 규제
| 수질 위해 등급(WGK) | 2 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | WO9275000 |
| 독성 | LD50 i.p. in mice: 1.06 g/kg (Bobranski) |
| 관세 코드 | 29350090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 23-24/25-36-26 |
| 기존화학 물질 | KE-01321 |
| F 고인화성물질 | 10 |
| 저장 분류 | 11 - Combustible Solids |
| 유해 물질 데이터 | 57-68-1(Hazardous Substances Data) |
용도
개요
Sulfamethazine is an antibacterial sulfonamide. Like other sulfonamides, sulfamethazine is bacteriostatic, competitively inhibiting dihydropteroate synthase to block folate synthesis and inhibit growth and multiplication. Sulfamethazine is metabolized by cytochrome P450 isoforms and arylamine N-acetyltransferase 2 in a sex-dependent manner.
용도
Sulfamethazine is an antibacterial.This compound is a contaminant of emerging concern (CECs).
일반 설명
Sulfamethazine’splasma half-life is 7 hours. This compound is similar inchemical properties to sulfamerazine and sulfadiazine butdoes have greater water solubility than either. Its pKa is 7.2.Because it is more soluble in acid urine than sulfamerazineis, the possibility of kidney damage from use of the drug isdecreased. The human body appears to handle the drugunpredictably; hence, there is some disfavor to its use in thiscountry except in combination sulfa therapy (in trisulfapyrimidines,USP) and in veterinary medicine.