술파메톡사졸
설파메톡사졸 · 술파메톡사졸 · 설파메톡사졸(SULFAMETHOXAZOLE) · SMX · SULPHAMETHOXAZOLE · SMZ · Sulfamethoxazol · Co-trimoxazole
식별자 및 물리적 특성
| CAS No. | 144930-01-8 |
|---|---|
| 분자식 | C10H11N3O3S |
| 평균 분자량 | 253.28 g/mol |
| 단동위원소 질량 | 253.05211239 g/mol |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)no1 |
| InChIKey | JLKIGFTWXXRPMT-UHFFFAOYSA-N |
| PubChem CID | 5329 |
| ChEMBL | CHEMBL443 |
| ChEBI | CHEBI:9332 |
| EC No. | 211-963-3 |
| DTXSID | DTXSID8026064 |
| 현지명 | 술파메톡사졸 |
화학 및 물리적 성질
| XLogP | 0.9 |
|---|---|
| 극성 표면적 | 107 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 17 |
| 형식 전하 | 0 |
| 복잡도 | 346 |
| 녹는점 | 166 °C |
| 끓는 점 | 482℃ |
| 밀도 | 1.3915 (rough estimate) |
| 굴절률 | 1.6630 (estimate) |
| 인화점 | >110°(230°F) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | 물에는 거의 녹지 않으며, 아세톤에는 잘 녹고, 에탄올에는 거의 녹지 않습니다(96%). 묽은 수산화나트륨 용액과 묽은 산에 용해됩니다. |
| pKa(산도 계수) | pKa 5.60±0.05 (Uncertain) |
| 물리적 상태 | Solid |
| 색상 | 흰색에서 연한 노란색 |
| 용해도 | 에탄올이나 아세톤에 용해됩니다. 물에 아주 약간 용해됨 |
| Merck | 14,8918 |
| BRN | 6732984 |
| 헨리 상수 | 1.5×107 mol/(m3Pa) at 25℃, HSDB (2015) |
| BCS Class | 2,4 |
| 안정성 | 안정적이지만 빛에 민감합니다. 강한 산화제와 호환되지 않습니다. |
| 주요 응용 | 법의학 및 독성학의약품(소분자) |
| InChI | 1S/C10H11N3O3S/c1-7-6-10(12-16-7)13-17(14,15)9-4-2-8(11)3-5-9/h2-6H,11H2,1H3,(H,12,13) |
| InChIKey | JLKIGFTWXXRPMT-UHFFFAOYSA-N |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(N)cc2)no1 |
| NIST | Sulfanilamide, n1-(5-methyl-3-isoxazolyl)-(723-46-6) |
| EPA | Sulfamethoxazole (723-46-6) |
화학적 성질
solid
안전 및 규제
| 수질 위해 등급(WGK) | 2 |
|---|---|
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | WP0700000 |
| 독성 | LD50 orally in mice: 3662 mg/kg (Yamamoto) |
| 관세 코드 | 29350090 |
| 위험 문구(R) | 36/37/38-43-22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-36-36/37/39-22 |
| 위험 등급 | IRRITANTAquatic Chronic 2Repr. 2 |
| 기존화학 물질 | KE-01462 |
| 저장 분류 | 11 - Combustible Solids |
| 유해 물질 데이터 | 723-46-6(Hazardous Substances Data) |
용도
개요
Like sulfisoxazole, this drug is effective in treating infections caused by streptococci, gonococci, pneumococci, staphylococci as well as colon bacillus. Unlike sulfisoxazole, only about 70% of it binds with proteins in the plasma after oral administration, and it diffuses mostly to tissues and tissue fluids. However, since it is removed much slower than sulfisoxazole, it does not require frequent administration and is also the drug of choice for many systemic infections. Moreover, it is an ingredient of a combined drug named bactrim, biseptol, and so on (which will be examined later on), which has a fixed correlation with trimethoprim. Synonyms of this drug are gantanol, sinomin, sulfisomezole, and others.
일반 설명
Sulfamethoxazole’s plasma half-life is 11 hours. Sulfamethoxazole is a sulfonamide drug closely relatedto sulfisoxazole in chemical structure and antimicrobial activity.It occurs as a tasteless, odorless, almost white crystallinepowder. The solubility of sulfamethoxazole in the pHrange of 5.5 to 7.4 is slightly lower than that of sulfisoxazole but higher than that of sulfadiazine, sulfamerazine, or sulfamethazine.Following oral administration, sulfamethoxazole is notabsorbed as completely or as rapidly as sulfisoxazole, andits peak blood level is only about 50% as high.