Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,2-Dichloro-4-fluoro-5-nitrobenzene
4,5-Dichloro-2-fluoronitrobenzene · BUTTPARK 89\07-58 · uoro-5-nitrobenzene · 1,2-DICHLORO-4-FLUOR · 3,4-Dichloro-2-fluoro-1-nitrobenzene · 4,5-Dichloro-2-fluoronitrobenzene95% · 1,2-Dichloro-4-fluoro-5-nitrobenzene · 4,5-Dichloro-2-fluoronitrobenzene 95%
식별자 및 물리적 특성
| CAS No. | 2339-78-8 |
|---|---|
| 분자식 | C6H2Cl2FNO2 |
| 평균 분자량 | 209.99 g/mol |
| 단동위원소 질량 | 208.94466188 g/mol |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)cc1F |
| InChIKey | FXOCDIKCKFOUDE-UHFFFAOYSA-N |
| PubChem CID | 533951 |
| EC No. | 607-228-5 |
| DTXSID | DTXSID90336466 |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 45.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 187 |
| 녹는점 | 17 °C (lit.) |
| 끓는 점 | 247 °C (lit.) |
| 밀도 | 1.596 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.575(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 저융점 고체 |
| 색상 | 옅은 노랑 |
| InChI | 1S/C6H2Cl2FNO2/c7-3-1-5(9)6(10(11)12)2-4(3)8/h1-2H |
| InChIKey | FXOCDIKCKFOUDE-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(Cl)c(Cl)cc1F |
화학적 성질
Off-White powder
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 2904990090 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 26-37/39 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
1,2-Dichloro-4-fluoro-5-nitrobenzene may be used in the combinatorial solid-phase synthesis of bis-heterocyclic compounds. It was employed as solute to investigate the possibility of selective excitation in coupled multispin systems.
일반 설명
Proton-detected local field (PDLF) spectra of 1,2-dichloro-4-fluoro-5-nitrobenzene in nematic solvents has been studied.