Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
바나듐(III) 아세틸아세토네이트
바나듐(III)아세틸아세토네이트 · 트리스(2,4-펜탄디오노)바나듐 · Vanadium trisacetylacetonate · VANADIUM ACETYLACETONATE · Vanadium(III) acetyL · Acetyl acetone vanadium · Vanadyltriacetylacetonate · Bis(pentanedionato) vanadyl
식별자 및 물리적 특성
| CAS No. | 13476-99-8 |
|---|---|
| 분자식 | C15H24O6V |
| 평균 분자량 | 351.29 g/mol |
| SMILES | CC(=O)/C=C(/C)O.CC(=O)/C=C(/C)O.CC(=O)/C=C(/C)O.[V] |
| InChIKey | MFWFDRBPQDXFRC-LNTINUHCSA-N |
| PubChem CID | 5377225 |
| 현지명 | 바나듐(III) 아세틸아세토네이트 |
화학 및 물리적 성질
| 극성 표면적 | 112 |
|---|---|
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 6 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 22 |
| 형식 전하 | 0 |
| 복잡도 | 380 |
| 물질 분류 | Metals -> Organic Compounds, Metal Salts |
| Physical Description | Blue powder[MSDSonline] |
| 녹는점 | 181-184 °C(lit.) |
| 끓는 점 | 170°C 0,05mm |
| 밀도 | 1.050 |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | soluble in methanol, acetone, benzene chloroform |
| 물리적 상태 | 수정 같은 |
| 색상 | 갈색 |
| 용해도 | 물 2g/L, 톨루엔, 에탄올, 아세톤에 용해됩니다. |
| BRN | 4148970 |
| InChI | 1S/3C5H8O2.V/c3*1-4(6)3-5(2)7/h3*3,6H,1-2H3/q+3/p-3/b3*4-3- |
| InChIKey | JTPOGAMSYINTGF-LNTINUHCSA-K |
| SMILES | CC(=O)\C=C(\C)O[V](O\C(C)=C/C(C)=O)O\C(C)=C/C(C)=O |
| LogP(분배 계수) | 0.05 |
| EPA | Vanadium, tris(2,4-pentanedionato-.kappa.O,.kappa.O')-, (OC-6-11)- (13476-99-8) |
화학적 성질
Blue to blue-green crystals. Decomposes before melting.
안전 및 규제
| 유해성 요약 | An irritant[MSDSonline] See Vanadium pentoxide. |
|---|---|
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3285 6.1/PG 3 |
| 위험 문구(R) | 36/37/38-25 |
| 위험 표시 | Xi,T |
| 안전 문구(S) | 26-36-45 |
| 포장분류 | III |
| 위험 등급 | 6.1Acute Tox. 3 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 기존화학 물질 | KE-35267 |
| F 고인화성물질 | 23-10 |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
Vanadium(III) acetylacetonate can be used as a soluble catalyst, which acts as a redox mediator that allows effective oxidation of lithium peroxide for lithium-ion batteries. It can also be used as source material for the preparation of vanadium dioxide films by chemical vapor deposition (CVD) technique.