Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-(4-((2-(2,4-Dichlorophenyl)-2-((1H-1,2,4-triazol-1-yl)methyl)-1,3-dioxolan-4-yl)methoxy)phenyl)-4-(propan-2-yl)piperazine
Terazol 3 · Triaconazole · R42470 · Fungistat · Terazol 7 · TERCONAZOLE · Terconagole · Gyno-Terazol
식별자 및 물리적 특성
| CAS No. | 67915-31-5 |
|---|---|
| 분자식 | C26H31Cl2N5O3 |
| 평균 분자량 | 532.5 g/mol |
| 단동위원소 질량 | 531.1803953 g/mol |
| SMILES | CC(C)N1CCN(c2ccc(OCC3COC(Cn4cncn4)(c4ccc(Cl)cc4Cl)O3)cc2)CC1 |
| InChIKey | BLSQLHNBWJLIBQ-UHFFFAOYSA-N |
| PubChem CID | 5404 |
| ChEMBL | CHEMBL1714574 |
| ChEBI | CHEBI:82979 |
화학 및 물리적 성질
| XLogP | 4.8 |
|---|---|
| 극성 표면적 | 64.9 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 7 |
| 회전 가능 결합 수 | 8 |
| 무거운 원자 수 | 36 |
| 형식 전하 | 0 |
| 복잡도 | 692 |
| 녹는점 | 126.3°C |
| 끓는 점 | 681.8±65.0 °C(Predicted) |
| 밀도 | 1.35±0.1 g/cm3(Predicted) |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | DMSO: 용해성1mg/mL |
| pKa(산도 계수) | 8.33±0.10(Predicted) |
| 물리적 상태 | 가루 |
| 색상 | 하얀색 |
| 주요 응용 | 법의학 및 독성학수의사 |
| InChIKey | BLSQLHNBWJLIBQ-GRHWAJSLNA-N |
| SMILES | N1(C2=CC=C(OC[C@H]3CO[C@@](C4=CC=C(Cl)C=C4Cl)(CN4C=NC=N4)O3)C=C2)CCN(C(C)C)CC1 |&1:7,10,r| |
화학적 성질
White or almost white powder.
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| RTECS 번호 | TL3564600 |
| 관세 코드 | 2934990002 |
| 위험 문구(R) | 36/37/38-53 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26 |
| 위험 등급 | Aquatic Chronic 4Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
개요
Terconazole is an antifungal agent somewhat more potent than clotrimazole and useful in the topical treatment of vaginal dermatophytosis and candidiasis.
용도
Terconazole belongs to a new chemical class of antifungal agents, the triazoles. Terconazole has a far greater selectively for yeast cytochrome P-450 than for mammalian microsomal cytochrome P-450 and is used as topical treatment of mycotic vaginitis. Terconazole may also be used in vitro as a potent antifungal agent to prevent the morphogenetic transformation of yeast into (pseudo-)mycelium form of Candida albicans.