Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
에틸이미다졸-2-카르복실레이트
에틸이미다졸-2-카르복실레이트 · Ethyl 1H-imidazole-2-carboxylate · RARECHEM AL BI 0666 · 2-Carboethoxyimidazole · Ethyl imidazole-2-formate · Ethyl 2-IMidazolecarboxylate · Ethyl imidaxole-2-carbolylate · Ethyl imidazole-2-carboxylate
식별자 및 물리적 특성
| CAS No. | 33543-78-1 |
|---|---|
| 분자식 | C6H8N2O2 |
| 평균 분자량 | 140.14 g/mol |
| 단동위원소 질량 | 140.0585775 g/mol |
| SMILES | CCOC(=O)c1ncc[nH]1 |
| InChIKey | UHYNYIGCGVDBTC-UHFFFAOYSA-N |
| PubChem CID | 549404 |
| ChEMBL | CHEMBL4554157 |
| EC No. | 681-997-5 |
| DTXSID | DTXSID20338498 |
| 현지명 | 에틸이미다졸-2-카르복실레이트 |
화학 및 물리적 성질
| XLogP | 0.6 |
|---|---|
| 극성 표면적 | 55 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 127 |
| 녹는점 | 176-178°C |
| 끓는 점 | 48-51°C 0,3mm |
| 밀도 | 1.214±0.06 g/cm3(Predicted) |
| 인화점 | 48-51°C/0.3mm |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 11.38±0.10(Predicted) |
| 색상 | 미색부터 페일 베이지까지 |
| BRN | 115685 |
| InChI | InChI=1S/C6H8N2O2/c1-2-10-6(9)5-7-3-4-8-5/h3-4H,2H2,1H3,(H,7,8) |
| InChIKey | UHYNYIGCGVDBTC-UHFFFAOYSA-N |
| SMILES | C1(C(OCC)=O)NC=CN=1 |
화학적 성질
Light brown powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 9 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 관세 코드 | 29332900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37 |
| 위험 참고 사항 | Irritant |
용도
용도
Ethyl Imidazole-2-carboxylate is an intermediate used to synthesize tricyclic quinoxalinone inhibitors of poly(ADP-ribose)polymerase-1 (PARP-1). It is also used to prepare imidazoindenopyrazinone carboxylic acid derivatives as AMPA antagonists with anticonvulsant activities.